***************************************************************** * * * Morrow Designs CBIOS for CP/M Ver 2.2. * * * * This CBIOS can be configured to run with the following * * devices. The disks may be configured to run with any or * * all of the disk systems. The logical order of the disks * * can be set to any order. * * * * Disk systems: * * HDC3 10, 20 and 26 megabyte hard disks. * * HDDMA 5, 16, 40 megabyte hard disk systems. * * DJDMA floppy controller with 8 and 5 1/4 inch disks. * * DJ 2D/B floppy controller with 8 inch disks. * * * * Console I/O: * * Disk Jockey 2D/B serial. * * Disk Jockey DMA serial. * * Multi I/O serial. * * Decision I serial. * * * * Printer I/O: * * Multi I/O serial with handshaking. * * Multi I/O Diablo 1620 simulator for the Hytype II. * * Multi I/O Centronics parallel. * * * * Note: Floppy systems diskette (drive A:) has to have 1024 * * byte sectors in order for the cold and warm boot * * loaders to work. Be sure to format all new * * system diskettes with 1024 byte sectors. The * * system diskette can be either single or double * * sided. The sector size on normal (non A: drive) * * diskettes is not restricted. Thus if you have a * * diskette with software that is supposed to run on * * the A: drive then you should mount the diskette * * in the B: drive and then PIP it over to a 1024 * * byte sector disktte. * * * * Written by Les Kent and Marc Kupper 3/4/82 * * * ***************************************************************** title 'CBIOS Revision E for CP/M Version 2.2 - March 4, 1982' revnum equ 52 ;Cbios revision number 5.x = E cpmrev equ 22 ;CP/M revision number 2.2 debug equ 0 ;Set for debugging mode ***************************************************************** * * * The following is set to the memory size of the CP/M the CBIOS * * is being created for. * * * ***************************************************************** msize equ 48 ;Memory size of target CP/M biosln equ 1500h ;BIOS length. Also in ABOOT&.ASM ***************************************************************** * * * The following equates set up the disk systems to be included * * along with the types of drives and the logical order of the * * drives. * * * ***************************************************************** maxhd equ 0 ;Set to number of HDC3 hard disk drives maxmw equ 1 ;Set to number of HDDMA hard disks maxfd equ 0 ;Set to number of 2D/B floppies maxdm equ 2 ;Set to number of DJ DMA floppies 8 inch maxmf equ 2 ;Set to number of DJ DMA floppies 5 1/4 inch hdorder equ 0 ;Set the order of logical drives ELSE 0 if mworder equ 1 ; not included. fdorder equ 0 dmorder equ 2 mforder equ 3 ;HDC3 controller disk drives. Set only one M26 equ 0 ;Shugart SA4000 M20 equ 0 ;Fujitsu M2302B M10F equ 0 ;Fujitsu M2301B M10M equ 0 ;Memorex ;HDDMA controller disk drives. Set only one M5 equ 1 ;Seagate M506 M16A equ 0 ;Ampex DF516 M16C equ 0 ;CMI 5616 M19 equ 0 ;CMI 5619 M40 equ 0 ;Quantum Q2040 wmdrive equ 0 ;Device to warm boot from. This is the ; CP/M logical drive number. badsiz equ 32 ;Number of badmap entries ***************************************************************** * * * Since most hard disk drives hold more than 8 megabytes we * * partition the drive. We partition our drives using two * * different formulas. * * * * One is the so called 'standard partitioning' where we try * * to create as many 8 megabyte partitions as possible plus * * a small partition to take up the slack on the end of the * * drive. * * * * Another way the drives are partitioned is the so called * * 'even partition' formula. This means that the drive is * * split into equale sized partitions with the only * * restriction being that no partition be over 8 megabytes * * in length. * * * * All hard disk drives shipped from Morrow Designs are * * partitioned using the standard partition formula. If the * * user wishes to implement even partitioning then he/she * * must set hdpart or mwpart to the number of partitions * * desired. * * * ***************************************************************** hdpart equ 0 ;Set to number of non standard partitions mwpart equ 0 ;Set to number of non standard partitions ***************************************************************** * * * The following equates define the console and printer * * environments. * * * ***************************************************************** ***************************************************************** * * * Define the console driver to be used. * * * * contyp is: 0 Nothing, used for patching to PROM's. * * 1 Provide for 128 bytes of patch space. * * 2 Multi I/O or Decision I driver. * * 3 2D/B driver. * * 4 DJDMA serial port * * * * Set cbaud to the divisor latch value for the console. * * For an explanation of the values look for the defcon * * table. * * * ***************************************************************** contyp equ 4 cbaud equ 0 ***************************************************************** * * * Define the printer driver to be used. * * * * lsttyp is: 0 Nothing, used for patching to PROM's. * * 1 Provide for 128 bytes of patch space. * * 2 Multi I/O serial, no protocol. * * 3 Multi I/O serial, CTS protocol. * * 4 Multi I/O serial, DSR protocol. * * 5 Multi I/O serial, Xon / Xoff protocol. * * 6 Multi I/O parallel, Centronics. * * 7 Multi I/O parallel, Diablo HyType II. * * * * Note: The Decision board is functionally identical to the * * Multi I/O board for printer I/O. Selections 2 - 6 * * will work on the Decision I. * * * * Set pbaud to the divisor latch value for the printer. * * For an explanation of the values look for the deflst * * table. * * * ***************************************************************** lsttyp equ 1 lbaud equ 0 ***************************************************************** * * * The next equate determines if you have a Multi I/O Rev 3 * * or a Decision I mother board for parallel i/o. If are not * * using either of these boards then you need not worry about * * this equate. If you are using a Multi I/O rev. other than * * 3.x then you should set multr3 to 0. * * * ***************************************************************** multr3 equ 0 ;0 = Decision, 1 = Multi I/O if contyp eq 2 congrp equ 1 ;Cosole port (1 = p1, 2 = p2, 3 = p3) endif if lsttyp ge 2 lstgrp equ 3 ;Printer port (1 = p1, 2 = p2, 3 = p3) endif ***************************************************************** * * * The following equates are internal to the CBIOS. * * * ***************************************************************** m10 equ m10f or m10m if hdpart ne 0 ;Use non standard partitions hdlog equ hdpart else hdlog equ m10*2+m20*3+m26*3 ;Logical disks per drive for HDC3 endif if mwpart ne 0 ;Use non standard partitions mwlog equ mwpart else mwlog equ m5*1+m16a*2+m16c*2+m19*2+m40*5 ;Logical disks per drive endif hdc3 equ m26 or m20 or m10 ;HDC3 controller fujitsu equ m20 or m10f hdrev equ 26*m26+20*m20+10*m10 ;Hard disk type hdspt equ 32*m26+21*m20+21*m10 ;Sectors per track hdma equ m5 or m16a or m16c or m19 or m40 ;HD DMA controller mwrev equ 05*m5+16*m16a+16*m16c+19*m19+40*m40 ;Hard disk type mwspt equ 9*m5+9*m16a+9*m16c+9*m19+9*m40 ;Sectors per track maxlog equ (maxhd*hdlog)+(maxmw*mwlog)+maxfd+maxdm+maxmf ***************************************************************** * * * The folowing equates will define the Decision I mother * * board I/O or the Multi I/O environments if needed. * * * ***************************************************************** multio equ (contyp eq 2) or (lsttyp ge 2) ;Multi I/O board used? if multio ;Define Multi I/O environment mbase equ 48h ;Base address of Multi I/O or Decision I grpsel equ mbase+7 ;Group select port dll equ mbase ;Divisor (lsb) dlm equ mbase+1 ;Divisor (msb) ier equ mbase+1 ;Interupt enable register clk equ mbase+2 ;WB14 printer select port lcr equ mbase+3 ;Line control register mcr equ mbase+4 lsr equ mbase+5 ;Line status register msr equ mbase+6 rbr equ mbase ;Read data buffer thr equ mbase ;Tranmitter data buffer dlab equ 80h ;Divisor latch access bit thre equ 20h ;Status line THRE bit cts equ 10h ;Clear to send dsr equ 20h ;Data set ready dr equ 1 ;Line status DR bit wls0 equ 1 ;Word length select bit 0 wls1 equ 2 ;Word length select bit 1 for 8 bit word stb equ 4 ;Stop bit count - 2 stop bits ; Define multi I/O ports addresses for group zero gzero equ 0 daisy0 equ mbase ;Daisy input ports daisy1 equ mbase+1 sensesw equ mbase+1 ;Sense switches if multr3 eq 0 ;Daisy output ports are different daisi0 equ mbase ; for Decision I and Multi I/O. daisi1 equ mbase+1 ;These two are the Decision I ports else daisi0 equ mbase+1 ; and these are the Multi I/O's. daisi1 equ mbase endif ; Define daisy 0 status input bits ribbon equ 01h ;End of ribbon paper equ 02h ;Paper out cover equ 04h ;Cover open pfrdy equ 08h ;Paper feed ready crrdy equ 10h ;Carriage ready pwrdy equ 20h ;Print wheel ready check equ 40h ;Printer check (error) ready equ 80h ;Printer ready ; Define daisy 0 status input bits for Diablo HyType II driver crstrd equ 1020h ;Carriage ready pfstrd equ 810h ;Paper feed ready pwstrd equ 2040h ;Print wheel ready ; Define daisy 0 output bits d9 equ 01h ;Data bit 9 d10 equ 02h ;Data bit 10 d11 equ 04h ;Data bit 11 d12 equ 08h ;Data bit 12 pfstb equ 10h ;Paper feed strobe crstb equ 20h ;Carriage strobe pwstb equ 40h ;Print wheel strobe rest equ 80h ;Printer restore (Ribbon lift on Multi I/O) ; Define clock select bits rlift equ 40h ;Ribbon lift pselect equ 80h ;Select (Not used by Diablo) ; Define Modem Control Register bits dtrenb equ 1 ;DTR enable rtsenb equ 2 ;RTS enable ; Define group select bits s0 equ 01h ;Group number (0-3) s1 equ 02h smask equ 03h bank equ 04h enint equ 08h restor equ 10h ;Printer restore on Multi I/O denable equ 20h ;Driver enable on Multi I/O ; Define special constants for the HyTyp II driver cperi equ 10 ;Default to 10 characters per inch lperi equ 6 ;Default lines per inch hinc equ 120 ;Horizontal increments per inch vinc equ 48 ;Vertical increments per inch numtabs equ 160 ;Number of horizontal tabs maxchrs equ 1024 ;Maximum number of printer characters to queue maxrgt equ 1584 ;Maximum carriage position dfrmln equ 110 ;Forms length times 10 autolf equ 0 ;Default to no Auto line feed. endif ***************************************************************** * * * CP/M system equates. * * * ***************************************************************** ccpln equ 800h bdosln equ 0e00h size equ (msize*1024) ccp equ size-(biosln+ccpln+bdosln) bdos equ ccp+ccpln bios equ ccp+ccpln+bdosln offsetc equ 2100h-bios ;Offset for sysgen if debug dbgtmp set offsetc ;DDT offset ! dbgtmp set ccp ;CCP address ! dbgtmp set bdos ;BDOS address ! dbgtmp set bios ;Cbios address ! endif cdisk equ 4 ;Address of last logged disk buff equ 80h ;Default buffer address tpa equ 100h ;Transient memory intioby equ 0 ;Initial IOBYTE iobyte equ 3 ;IOBYTE location wbot equ 0 ;Warm boot jump address entry equ 5 ;BDOS entry jump address ***************************************************************** * * * The following are internal Cbios equates. Most are misc. * * constants. * * * ***************************************************************** retries equ 10 ;Max retries on disk i/o before error clear equ 'Z'-64 ;Clear screen on an ADM 3 anul equ 0 ;Null aetx equ 'C'-64 ;ETX character aack equ 'F'-64 ;ACK character abel equ 'G'-64 ;Bell abs equ 'H'-64 ;Back Space aht equ 'I'-64 ;Horizontal tab alf equ 'J'-64 ;Line feed avt equ 'K'-64 ;Vertical tab aff equ 'L'-64 ;Form Feed acr equ 'M'-64 ;Carriage return xon equ 'Q'-64 ;Xon character xoff equ 'S'-64 ;Xoff character aesc equ 1bh ;Escape character ars equ 1eh ;RS character aus equ 1fh ;US character asp equ ' ' ;Space adel equ 7fh ;Delete ***************************************************************** * * * The following are the macros used in generating the DPH, DPB * * and allocation tables. * * * ***************************************************************** dpbgen macro nam,log,dspt,dbsh,dblm,dexm,ddsm,ddrm,dal0,dal1,dcks,doff dpb&nam&log equ $ dw dspt db dbsh db dblm db dexm dw ddsm dw ddrm db dal0 db dal1 dw dcks dw doff db 0 endm dphgen macro nam,log,dpb1,dpb2 dph&nam&log equ $ dw 0 dw 0,0,0 dw dirbuf dw &dpb1&dpb2 dw csv&nam&log dw alv&nam&log endm alloc macro nam,log,al,cs csv&nam&log: ds cs alv&nam&log: ds al endm ***************************************************************** * * * The following marco is used in generating the logical order * * of the CP/M drives. * * * ***************************************************************** order macro num if num eq hdorder dw hddst endif if num eq mworder dw mwdst endif if num eq fdorder dw fddst endif if num eq dmorder dw dmdst endif if num eq mforder dw mfdst endif endm ***************************************************************** * * * The folloing are offset numbers of Device Specification * * Tables. * * * ***************************************************************** d.wboot equ 0 ;Warm boot d.stran equ 1 ;Sector translation d.sel1 equ 2 ;Drive select, Return DPH d.sel2 equ 3 ;Drive select d.home equ 4 ;Home drive d.strk equ 5 ;Set track d.ssec equ 6 ;Set sector d.sdma equ 7 ;Set DMA address d.read equ 8 ;Read a physical sector d.write equ 9 ;Write a physical sector d.bad equ 10 ;Return pointer to bad sector info ***************************************************************** * * * The jump table below must remain in the same order, the * * routines may be changed, but the function executed must be * * the same. * * * ***************************************************************** org bios ;Cbios starting address jmp cboot ;Cold boot entry point wboote: jmp wboot ;Warm boot entry point if contyp ne 0 const: jmp cstty ;Console status routine cin: jmp ciflsh ;Console input cout: jmp cotty ;Console output else jmp $ ;Console status routine PROM pointer cin: jmp $ ;Console input PROM pointer cout: jmp $ ;Console output PROM pointer endif if lsttyp ne 0 jmp list ;List device output else jmp cout ;List device output endif jmp punch ;Punch device output jmp reader ;Reader device input jmp home ;Home drive jmp setdrv ;Select disk jmp settrk ;Set track jmp setsec ;Set sector jmp setdma ;Set DMA address jmp read ;Read the disk jmp write ;Write the disk if lsttyp ne 0 jmp listst ;List device status else jmp $ ;List device status endif jmp sectran ;Sector translation if maxfd ne 0 jmp fdsel ;Hookup for SINGLE.COM program else jmp donop endif ***************************************************************** * * * Immediatly following the SINGLE hookup jump we have a * * series of pointers that point to various internal tables. * * At the start of each of these tables we have a revision * * byte and a length byte. The revision byte is the * * current revision number for that particular structure and * * the length byte is the length of that structure. This * * length does not include the revision byte nor the length * * byte. * * * * The pointers defined so far are as follows: * * * * 1) This points to the drive configuration table. * * * * 2) This points to the I/O configuration bytes for * * the serial drivers. Eg, the console, printer, * * reader, and punch devices. * * * * 3) This will be a null (0) pointer. It marks the * * end of the table. * * * ***************************************************************** dw drconf ;Drive configuration table pointer dw ioconf ;I/O configuration table pointer dw 0 ***************************************************************** * * * Drive configuration table. * * * ***************************************************************** drconf: db 0 ;Revision 0 structure db 32 ;32 bytes long now ***************************************************************** * * * The following is the table of pointers to the Device * * Specification Tables. The order of this table defines * * the logical order of the CP/M drives. * * * ***************************************************************** dsttab: equ $ dn set 1 rept 16 order %dn dn set dn+1 endm ***************************************************************** * * * I/O configuration table. * * * ***************************************************************** ioconf: db 0 ;Revision 0 structure db 5 ;5 bytes long now ***************************************************************** * * * The following two words define the default baud rate for * * the console and the LST: devices. These words must * * immediatly follow the Cbios jump table so that the user * * can easly modify them and that they will also be used in * * the future by Morrow Designs software. * * * * The following is a list of possible baud rates and the * * value needed for the defcon or deflst words. * * * * Baud rate defcon/deflst Baud rate defcon/deflst * * 50 2304 2000 58 * * 75 1536 2400 48 * * 110 1047 3600 32 * * 134.5 857 4800 24 * * 150 768 7200 16 * * 300 384 9600 12 * * 600 192 19200 6 * * 1200 96 38400 3 * * 1800 64 56000 2 * * * ***************************************************************** defcon: dw cbaud ;Console baud rate deflst: dw lbaud ;Printer baud rate ***************************************************************** * * * The next byte is to make sure that the group select byte * * on the Mult I/O or Decsion I stays consistant throughout * * the Cbios. Only the group bits themselves (bits 0 and 1) * * should be changed as you output to the group port. If * * you modify one of the other bits (such a driver-enable) * * then you should modify the same bit in the group byte * * provided. Example: * * * * ;Select console group * * lda group ;Get group byte * * ori congrp ;Select the console port * * out grpsel ;Select the group * * * * ;Modify a bit in the group byte * * lda group ;Get group byte * * ori bank ;Set the bank bit * * sta group ;Save new group setting * * ori group2 ;Select second serial port * * out grpsel ;Select the desired group * * * * Note: You should not set the group bits themselves in * * the group byte. * * * ***************************************************************** group: db 0 ;Group byte ***************************************************************** * * * Console driver routines. * * * * Routine used depends on the value of contyp. Possible * * contyp values are listed as follows: * * * * contyp is: 0 Nothing, used for patching to PROM's. * * 1 Provide for 128 bytes of patch space. * * 2 Multi I/O or Decision I driver. * * 3 2D/B driver. * * 4 DJDMA serial port * * * ***************************************************************** ciflsh: call flush ;Flush disk buffers on input jmp citty ***************************************************************** * * * contyp: 1 Blank space for console driver * * * * Note: If the user plans to utilize this space then the * * one time code such as tinit{sould be placed just below * * the cboot routine. This space (belowe cboot) is recyled * * for use as a disk buffer after cboot is done. * * * ***************************************************************** if contyp eq 1 tinit equ $ ;Make it easy to find this place cotty equ $ citty equ $ cstty equ $ ret ds 127 endif ;Blank space ***************************************************************** * * * contyp: 2 Multi I/O or Decision I console driver * * * ***************************************************************** if contyp eq 2 ***************************************************************** * * * This driver on cold boot will inspect bits 1-3 of the sense * * switches. If the value found is in the range 0-6 then the * * console baud rate will be taken from the rate table. * * Otherwise the current divisor latch value will be checked. * * If the divisor seems to be ok then no action will be taken * * as far as the baud rate setting goes. If the divisor is not * * ok then the baud rate will be set from the DEFCON word * * which is found just below the regular Cbios jump table. The * * standard divisor table is given below. * * * * Sense switch: 123 (0 = off, 1 = on) * * 000 = 110 * * 001 = 300 * * 010 = 1200 * * 011 = 2400 * * 100 = 4800 * * 101 = 9600 * * 110 = 19200 * * defcon = 9600 * * * * Note: If you are compiling with multr3 (a Multi I/O) then * * the switches will not be available so the baud rate * * will be taken from defcon. * * * ***************************************************************** ***************************************************************** * * * Due to its length, the tinit routine driver is below the * * cboot routine. * * * ***************************************************************** ***************************************************************** * * * Read a character from the serial port. * * * ***************************************************************** citty: lda group ;Get group byte ori congrp ;Select console out grpsel conin1: in lsr ;Read status register ani dr ;Wait till character ready jz conin1 in rbr ;Read character ani 7fh ;Strip parity ret ***************************************************************** * * * Output a character to serial port. * * * ***************************************************************** cotty: lda group ;Get group byte ori congrp ;Select console out grpsel conout1:in lsr ;Read status ani thre ;Wait till transmitter buffer empty jz conout1 mov a,c ;Character is in (c) out thr ;Output to transmitter buffer ret ***************************************************************** * * * Return serial port status. Returns zero if character is not * * ready to be read. Else returns 255 if ready. * * * ***************************************************************** cstty: lda group ;Get group byte ori congrp ;Select console out grpsel in lsr ;Read status register ani dr rz ;No charactter ready mvi a,0ffh ;Character ready ret endif ;Multi I/O or Decision I ***************************************************************** * * * contyp: 3 2DB console driver * * * ***************************************************************** if contyp eq 3 cotty: jmp fdcout ;Console output citty: jmp fdcin ;Console input cstty: call fdtstat ;Console status mvi a,0ffh rz inr a ret endif ;2DB ***************************************************************** * * * contyp: 4 DJDMA console driver * * * ***************************************************************** if contyp eq 4 cotty: lxi h,dmchan mvi m,serout ;Command for serial output inx h mov m,c jmp docmd citty: lxi h,serin+1 ;Serial input status xra a ci2: cmp m ;Wait till 40h deposited at 3fH jz ci2 mov m,a ;Clear status dcx h ;Point to input data mvi a,7fh ;For masking out parity ana m ret cstty: lda serin+1 ;Pick up serial input status ora a rz ;If zero then no character ready mvi a,0ffh ;Set character ready ret endif ***************************************************************** * * * LST: device driver routines. * * * * Routine used depends on the value of lsttyp. Possible * * lsttyp values are listed as follows: * * * * lsttyp is: 0 Nothing, used for patching to PROM's. * * 1 Provide for 128 bytes of patch space. * * 2 Multi I/O serial, no protocol. * * 3 Multi I/O serial, CTS protocol. * * 4 Multi I/O serial, DSR protocol. * * 5 Multi I/O serial, Xon / Xoff protocol. * * 6 Multi I/O parallel, Centronics. * * 7 Multi I/O parallel, Diablo HyType II. * * * ***************************************************************** ***************************************************************** * * * lsttyp: 1 Blank space for printer driver * * * * Note: If the user plans to utilize this space then the * * one time code such as linit sould be placed just below * * the cboot routine. This space (belowe cboot) is recyled * * for use as a disk buffer after cboot is done. * * * ***************************************************************** if lsttyp eq 1 linit equ $ ;Make it easy to find this place list equ $ listst equ $ ret ds 127 endif ;Blank space ***************************************************************** * * * lsttyp: 2 Serial printer, no protocol * * * * lsttyp: 3 Serial printer, CTS protocol * * * * lsttyp: 4 Serial printer, DSR protocol * * * * lsttyp: 5 Serial printer, Xon / Xoff protocol * * * ***************************************************************** if (lsttyp ge 2) and (lsttyp le 5) list: lda group ;Get group byte ori lstgrp ;Select list device out grpsel ll: in lsr ani thre ;Wait till transmitter buffer empty jz ll ***************************************************************** * * * The CTS driver is used for a printer with hardware * * handshaking (TI 810). It should be connected to the CTS * * input on the list device serial port. * * * ***************************************************************** if lsttyp eq 3 ;CTS protocol in msr ani cts ;Wait till clear to send jz ll endif ***************************************************************** * * * The DSR driver is used for a printer with hardware * * handshaking (TI 810). It should be connected to the DSR * * input on the list device serial port. * * * ***************************************************************** if lsttyp eq 4 ;DSR protocol in msr ani dsr jz ll ;Wail till DSR comes up endif ***************************************************************** * * * The Xon/Xoff driver is used for a printer with software * * handshaking (Diablo 630). * * * ***************************************************************** if lsttyp eq 5 ;Xon / Xoff protocol xloop: call listst ;Check printer status ora a jz xloop ;Loop if not ready endif mov a,c out thr ret listst: lda group ;Get group byte ori lstgrp ;Select list device out grpsel in lsr ;Check if transmitter buffer empty ani thr rz ;Return not ready if lsttyp eq 3 ;CTS protocol in msr ani cts rz ;Return not ready if CTS is false endif if lsttyp eq 4 ;DSR protocol in msr ani dsr rz ;Return not ready if DSR is true endif if lsttyp eq 5 ;Xon / Xoff protocol mvi b,xon ;Last character recieved from printer lstflg equ $-1 in lsr ani dr ;Check for a character jz xskip ;No character present in rbr ;Get character ani 7fh mov b,a ;Save sta lstflg ;Kludge flag (last character recieved) xskip: mov a,b sui xoff ;Check for Xoff char (control S) jnz xsdone ;Printer ready ret ;Printer not ready xsdone equ $ ;Printer ready for data endif mvi a,0ffh ret ;Printer ready endif ;Multi I/O serial ***************************************************************** * * * lsttyp: 6 Centronics parallel printer driver. * * * ***************************************************************** if lsttyp eq 6 ***************************************************************** * * * Decision I Diablo parallel to Centronics parallel interface. * * * * The following cable must be made from the 50 pin Diablo * * conector to the 35 pin Centronics. * * * * Centronics Multi I/O * * pin signal pin signal * * 1 /strobe <- 46 /d9 * * 2 data1 <- 37 /d1 * * 3 data2 <- 36 /d2 * * 4 data3 <- 39 /d3 * * 5 data4 <- 33 /d4 * * 6 data5 <- 40 /d5 * * 7 data6 <- 42 /d6 * * 8 data7 <- 43 /d7 * * 9 data8 <- 45 /d8 * * 10 /acknlg -> 12 /check * * 11 busy -> 28 /printer ready * * 12 pe -> 3 /paper * * 13 slct -> 4 /ribbon * * 14 /auto feed xt <- 1 /d10 * * 15 NC * * 16 0V <-> 2 GND * * 17 chassis gnd * * 18 NC * * 19 /strobe rtn <-> 8 GND * * 20 data1 rtn <-> 11 GND * * 21 data2 rtn <-> 14 GND * * 22 data3 rtn <-> 16 GND * * 23 data4 rtn <-> 18 GND * * 24 data5 rtn <-> 20 GND * * 25 data6 rtn <-> 22 GND * * 26 data7 rtn <-> 25 GND * * 27 data8 rtn <-> 38 GND * * 28 /acknlg rtn <-> 41 GND * * 29 busy rtn <-> 44 GND * * 30 pe rtn <-> 47 GND * * 31 /init <- 9 /d11 * * 32 /error -> 5 /cover * * 33 GND <-> 35 GND * * 34 NC * * 35 /slct in <- 10 /d12 * * 35 <-> 24 /Select * * * * IMPORTANT: For this interface to work /select (24) on the * * parallel conector must be tied to ground (35). * * * ***************************************************************** list: lda group ;Get group byte out grpsel rl: in daisy0 ;Wait till printer ready and selected ani ready+paper jz rl pl: in daisy0 ;Test if out of paper ani ribbon jnz pl el: in daisy0 ani cover jnz el mov a,c ;Move character into (a) out daisi1 ;Latch data mvi a,d11+d10+d9 ;Make sure strobe is high out daisi0 dcr a ;Pulse strobe low out daisi0 inr a out daisi0 ack: in daisy0 ;Wait till ready again ani ready jz ack ret listst: lda group ;Get group byte out grpsel ;Select group zero in daisy0 ;Wait till printer ready and selected ani ready+paper rz in daisy0 ;Test if out of paper ani ribbon rz in daisy0 ani cover xri cover rz dcr a ret endif ;Centronics parallel if lsttyp eq 7 ;Diablo HyTyp II ***************************************************************** * * * Diablo 1620 simulator for the Diablo Hytype II. * * * ***************************************************************** ***************************************************************** * * * This routine does all of the character decoding, escape * * sequences forward, backward, etc. The list of escape * * sequences, and special characters recognized is: * * * * adel ignored * * anul ignored * * aack ignored (when received) * * abel ignored * * aff form feed * * aetx etx/ack handshake * * aht horizontal tab * * alf line feed * * asp space * * abs backspace * * acr carriage return * * aesc 0 ignored * * aesc 1 set tab stop at current print position * * aesc 2 clear all tab stops * * aesc 3 graphics mode on * * aesc 4 graphics mode off * * aesc 5 forward print * * aesc 6 backward print * * aesc 8 clear tab stop * * aesc 9 set left margin * * aesc A ignored * * aesc B ignored * * aesc D negative half line feed * * aesc U half line feed * * aesc alf negative line feed * * aesc aht c absolute horizontal tab * * aesc avt c absolute vertical tab * * aesc ars c set vmi * * aesc aus c set hmi * * * ***************************************************************** list: lda group ;Set printer initialized flag ori denable sta group mov a,c ;Get the character to print ani 7fh ;Strip off parity rz cpi adel ;Ignore delete rz mov c,a ;Save character lda escflg lxi h,level0 ;Level zero characters ana a mov a,c ;Scan for char in A jz lookup ;Look up activity for this character lda escflg lxi h,level1 ;Single character escape sequences cpi aesc mov a,c ;Scan for char in A jz lookup ;Execute single level escape sequence lxi h,level2 ;Two character escape sequence lda escflg ***************************************************************** * * * Lookup scans the table pointed at by HL looking for a match * * of the character in register A. * * * ***************************************************************** lookup: dcr m ;Test if end of table inr m jz gother ;Execute the default function cmp m ;Otherwise test for a match jz gother inx h ;Bump over character inx h ;Bump over function address inx h jmp lookup gother: inx h ;Bump over character mov a,m ;Get low byte of function address inx h mov h,m ;Get high byte of function address mov l,a ;Form Address of function pchl ;Execute it ***************************************************************** * * * Each of the following tables contains entries of the form: * * 1 byte character to match * * 2 bytes of address to execute * * terminated by a first byte of 0. * * * ***************************************************************** level0: db aesc dw doaesc ;Beginning of an escape sequence db aff dw doaff ;Form feed db aetx dw doaetx db aht dw doaht ;horizontal tab db alf dw doalf ;Line feed db asp dw doasp ;Space db abs dw doabs ;Back space db acr dw doacr ;Carriage return db 0 dw dochar ;Any other character level1: db '1' dw sethtab ;Set horizontal tab db '2' dw clrall ;Clear all horizontal tabs db '3' dw setgrp ;Graphics mode db '4' dw clrgrp ;Clear graphics mode db '5' dw clrdir ;Forward printing db '6' dw setdir ;Backward printing db '8' dw clrhtab ;Clear horizontal tab db '9' dw setlmar ;Set left margin db '0' dw func1 ;No operation level 1 db 'A' dw func1 db 'B' dw func1 db 'a' dw func1 db 'b' dw func1 db 'D' dw neghlf ;Negative half line feed db 'U' dw poshlf ;Half line feed db alf dw neglf ;Negative line feed db aht dw settwo ;Two character escape sequence db avt dw settwo db ars dw settwo db aus dw settwo db 0 dw func1 level2: db aht dw abshtab ;Absolute horizontal tab db avt dw absvtab ;Absolute vertical tab db ars dw setvmi db aus dw sethmi db 0 dw func2 ***************************************************************** * * * The following routines execute escape sequences, etc. * * * ***************************************************************** settwo: doaesc: mov a,c ;Get the escape character sta escflg func0: ret doaetx: ret doalf: call lfvmi ;Get line feed vmi adjvp: xchg lhld dlvpos ;Get vertical motion displacement dad d shld dlvpos ret lfvmi: lda grhflg ana a lxi h,1 ;Only 1/48 if in graphics mode rnz lhld vmi ;Get vertical motion index ret neglf: call lfvmi ;Get line feed vmi call neghl call adjvp jmp func1 doasp: call sphmi ;Get space horizontal motion spdir: lda dirflg ;Forward or backwards ? ana a cnz neghl ;Negate HL adjhp: xchg ;Adjust Horizontal position lhld dlhpos ;Get current adjustment dad d ;Update it shld dlhpos ;And save ret sphmi: lda grhflg ;In graphics mode ? ana a lxi h,2 ;Only 1/60 if in graphics mode rnz lhld hmi ret doabs: call sphmi ;Space increment call neghl ;Negative to start with jmp spdir ;Adjust backwards doacr: xra a sta dirflg ;Forward printing sta grhflg ;No graphics mode lhld hpos ;Get current offset xchg lhld lmar ;Get left margin call hlmde shld dlhpos ;Don't move yet though mvi a,autolf ;In Auto line feed mode ? ana a jnz doalf ;Do line feed also ret dochar: mov l,c mvi h,0 call wheel ;Print the character in register C lda grhflg ana a lxi h,0 ;Don't move if in graphics mode jnz spdir lhld hmi jmp spdir clrall equ $ ;Clear all horizontal tabs lxi h,tabstp ;Beginning of tab stop array mvi d,tablen ;Size of tab array (bytes) notblp: mvi m,80h ;Reset tabs (reset to 0 later) kludge equ $-1 ;Used on first reset (warmboot) inx h ;Next tab stop dcr d ;Update repeat count jnz notblp ;Continue zeroing func2 equ $ func1: xra a ;Clear escape sequence flag sta escflg ret setgrp: mvi a,1 ;Set graphics mode on sta grhflg jmp func1 clrgrp: xra a ;Turn graphics mode off sta grhflg jmp func1 clrdir: xra a ;Forward print mode sta dirflg jmp func1 setdir: mvi a,a ;Set backward printing mode sta dirflg jmp func1 setlmar:lhld hpos ;Get current position xchg lhld dlhpos ;Get offset dad d shld lmar jmp func1 setvmi: mov l,c ;Set the motion index mvi h,0 dcx h shld vmi jmp func2 sethmi: mov l,c mvi h,0 dcx h shld hmi jmp func2 poshlf: call hlfvmi ;Half line feed vmi call adjvp jmp func1 neghlf: call hlfvmi ;Negative half line feed call neghl call adjvp jmp func1 hlfvmi: lhld vmi ;Get vmi for full line feed divid2: mov a,h ;High byte ora a ;Clear the carry rar mov h,a mov a,l rar mov l,a ret abshtab:mov e,c ;Absolute horizontal tab mvi d,0 dcx d ;Form 16 bit tab column call newdlh jmp func2 newdlh: lhld hmi call hltde ;Multiply by hmi xchg lhld hpos ;And subtract current horizontal position xchg call hlmde shld dlhpos ret absvtab:mov e,c ;Absolute vertical tab mvi d,0 dcx d lhld vmi call hltde ;Multiply by vmi xchg lhld vpos ;And subtract the current vertical position xchg call hlmde shld dlvpos jmp func2 sethtab:call tabcol ;Set horizontal tab ora m ;OR in tab stop mov m,a ; and save jmp func1 tabcol: lhld hpos ;Compute address of current character col xchg lhld dlhpos dad d ;Get logical position xchg lhld hmi ;And divide by hmi to get character column xchg call hldde mtabp: ;Make a tab pointer ;HL -> Tab column desired (1-160) ;HL <- address of tab stop ; A <- bit mask for tab stop lxi d,8 ;Number of stops per byte call hldde ;HL/DE -> HL, HL mod DE -> DE mov c,e ;Save inr c ;Make range (1-8) lxi d,tabstp ;Tab array dad d ;Make array pointer xra a stc mtab0: rar dcr c ;Bump bit counter jnz mtab0 ret clrhtab:call tabcol ;Clear horizontal tab cma ana m ;Mask out tab stop mov m,a jmp func1 doaht: lhld hpos ;Compute address of current character col xchg lhld dlhpos dad d ;Get logical position xchg lhld hmi ;And divide by hmi to get character column xchg call hldde tablop: lxi d,numtabs inx h ;Start with next position call hlcde ;Compare position with number of tabs jnc tofar ;Past last tab push h ;Save col pointer call mtabp ;Generate tab pointer ana m ;Check out tab stop pop h ;Restore col pointer jz tablop ;Loop if stop not set xchg jmp newdlh ;Set new col position and return tofar: lhld hpos ;Go all the way to the right xchg lxi h,maxrgt call hlmde shld dlhpos ret doaff: lxi h,dfrmln ;Multiply forms length by 48 lxi d,48 call hltde lxi d,10 call hldde ;And divide it by 10 push h ;Save this result lhld vpos ;Get logical vertical position xchg lhld dlvpos dad d pop d push d ;Get copy of forms length call hldde ;HL mod DE xchg pop d xchg call hlmde xchg lhld dlvpos dad d shld dlvpos jmp papr ***************************************************************** * * * Neghl forms the twos complement of HL. * * * ***************************************************************** neghl: mov a,h cma mov h,a mov a,l cma mov l,a inx h ret ***************************************************************** * * * Hlmde subtracts DE from HL and returns. * * * ***************************************************************** hlmde: xchg call neghl xchg dad d ret ***************************************************************** * * * Hlcde compares HL with DE. On return the Z flag is set if * * they are equal, the Carry flag is set if HL is less than DE. * * * ***************************************************************** hlcde: mov a,h cmp d rnz mov a,l cmp e ret ***************************************************************** * * * Divide the number in HL by the number in DE. Return the * * quotient in HL and the remainder in DE. * * * ***************************************************************** hldde: mov a,d ;Start by negating DE and cma ; moving the left operand to BC mov b,a mov a,e cma mov c,a inx b mvi a,16 ;Repeat count in reg A lxi d,0 ;Initial remainder is zero div3: dcr a ;Test if done rm ;All done ? dad h ;Shift right operand to the left xchg push psw ;Save carry dad h ;Shift left operand to the left pop psw jnc div1 ;Does it fit ? inx h div1: push h dad b jnc div2 xchg inx h xthl pop h jmp div3 div2: pop h xchg jmp div3 ***************************************************************** * * * Multiply the contents of HL by the contents of DE. * * * ***************************************************************** hltde: mov c,l mov b,h lxi h,0 mult: mov a,b ora c rz mov a,b ora a rar mov b,a mov a,c rar mov c,a cc dadde xchg dad h xchg jmp mult dadde: dad d ret ***************************************************************** * * * The routines below actually interface to the printer, * * causing paper feed, carriage, and print wheel motion. * * * ***************************************************************** carrg: lhld dlhpos ;Check for any accumulated motion mov a,h ora l rz lhld hpos ;Check for too much motion xchg lhld dlhpos dad d mov a,h ana a jp lftok lhld hpos call neghl shld dlhpos lftok: lhld hpos xchg lhld dlhpos dad d lxi d,maxrgt call hlcde jc rgtok lhld hpos ;Otherwise move only to maxright xchg lxi h,maxrgt call hlmde shld dlhpos rgtok: lhld hpos ;Update the horizontal position xchg lhld dlhpos dad d shld hpos lhld dlhpos ;check if required motion is to the left mov a,h ana a mvi c,0 jp posh call neghl mvi c,d11 posh: xchg lxi h,0 shld dlhpos ;Reset the horizontal increment xchg mov a,l ani 1 jz nohhlf ;No half spaces mov a,c ori d12 mov c,a nohhlf: call divid2 mov a,h ani d9+d10 ora c mov h,a lxi d,crstrd jmp cmnd papr: lhld dlvpos ;Check for any paper motion mov a,h ora l rz ;No motion mov a,h ana a mvi c,0 jp posv call neghl mvi c,d11 posv: mov a,h ani d9+d10 ora c mov h,a push h ;Save paper motion lhld vpos xchg lhld dlvpos ;Get logical position dad d push h ;Save for now lxi h,dfrmln ;Get default form length lxi d,48 call hltde ;Multiply by 48 lxi d,10 call hldde ;Divide by 10 pop d xchg call hldde ;Compute HL mod DE xchg shld vpos ;Save new vertical position lxi h,0 shld dlvpos ;Reset vertical motion pop h lxi d,pfstrd ;Paper feed strobe jmp cmnd wheel: push h call carrg ;Position the carriage first call papr pop h lxi d,pwstrd cmnd: lda group ;Get group byte out grpsel ;Select group zero cmnd0: in daisy0 ana d jz cmnd0 mov a,l ;Negate low data bits cma mov l,a mov a,h ani d9+d10+d11+d12 ;Mask in data bits only cma if multr3 ;Mask out ribbon lift bit on Multi I/O ani 0ffh-rest endif mov h,a mov a,l out daisi1 ;Output low bits mov a,h out daisi0 ;Output high bits xra e ;Slap strobe bits in out daisi0 mov a,h ;And drop strobes back down out daisi0 ret ***************************************************************** * * * New list device status routine. Returns 0ffh if the printer * * can except another character, otherwise it returns 0. * * * ***************************************************************** listst: lda group ;Check printer initialized flag ani denable rz ;0 = printer not initialized lda group ;Get group byte out grpsel ;Select group zero lxi d,pwstrd in daisy0 ana d xra a rz cma ret ***************************************************************** * * * Dynamic data locations used by the simulator. * * * ***************************************************************** hmi: dw 0 ;Horizontal motion index. Set by linit ; and escape sequences. vmi: dw 0 ;Vertical motion index. Set by linit ; and escape sequences. vpos: dw 0 ;Vertical position. Set by platen motion dlvpos: dw 0 ;Delta vpos. Set by platen motion hpos: dw 0 ;Horizontal position. Set by carriage motion dlhpos: dw 0 ;Delta hpos. Set by carriage motion lmar: dw 0 ;Left margin dirflg: db 0 ;Direction flag grhflg: db 0 ;Graphics mode flag escflg: db 0 ;Escape sequence in progress flag tabstp: ds numtabs/8+1 ;Tab stops bit array tablen equ numtabs/8+1 ;Length of tabs array endif ***************************************************************** * * * The following routines are used to make the reader and punch * * devices peform I/O through the console. The user may patch * * here for their particular devices. * * * ***************************************************************** punch: jmp cout reader: jmp cin ***************************************************************** * * * Gocpm is the entry point from cold boots, and warm boots. It * * initializes some of the locations in page 0, and sets up the * * initial DMA address (80h). * * * ***************************************************************** gocpm: lxi h,buff ;Set up initial DMA address call setdma mvi a,(jmp) ;Initialize jump to warm boot sta wbot sta entry ;Initialize jump to BDOS lxi h,wboote ;Set up low memory entry to CBIOS warm boot shld wbot+1 lxi h,bdos+6 ;Set up low memory entry to BDOS shld entry+1 xra a ;A <- 0 sta bufsec ;Set buffer to unknown state sta bufwrtn ;Set buffer not dirty flag lda cwflg ;Get cold/warm boot flag ora a lxi d,coldbeg ;Beginning of initial command mvi a,coldend-coldbeg+1 ;Length of command jz cldcmnd lxi d,warmbeg mvi a,warmend-warmbeg+1 cldcmnd:lxi h,ccp+8 ;Command buffer sta ccp+7 ;Store length in CCP internal buffer mov c,a mvi b,0 call movbyt ;Move command to internal CCP buffer lda cwflg ora a lda autoflg jz cldbot rar cldbot: rar lda cdisk ;Jump to CP/M with currently selected disk in C mov c,a jc ccp jmp ccp+3 ;Enter CP/M cwflg: db 0 ;Cold/warm boot flag ***************************************************************** * * * The following byte determines if an initial command is to be * * given to CP/M on warm or cold boots. The value of the byte is * * used to give the command to CP/M: * * * * 0 = never give command. * * 1 = give command on cold boots only. * * 2 = give the command on warm boots only. * * 3 = give the command on warm and cold boots. * * * ***************************************************************** autoflg:db 0 ;Auto command feature ***************************************************************** * * * If there is a command inserted here, it will be given if the * * auto feature is enabled. * * For Example: * * * * coldbeg db 'MBASIC MYPROG' * * coldend db 0 * * * * will execute microsoft basic, and mbasic will execute the * * "MYPROG" basic program. * * * ***************************************************************** coldbeg:db '' ;Cold boot command goes here coldend:db 0 warmbeg:db '' ;Warm boot command goes here warmend:db 0 ***************************************************************** * * * WBOOT loads in all of CP/M except the CBIOS, then initializes * * system parameters as in cold boot. See the Cold Boot Loader * * listing for exactly what happens during warm and cold boots. * * * ***************************************************************** wboot: lxi sp,tpa ;Set up stack pointer mvi a,1 sta cwflg ;Set cold/warm boot flag mvi h,wmdrive ;Move drive to warm boot off of into (h) mvi l,d.wboot ;Peform warm boot operation call jumper jnc gocpm ;No error hlt ;Halt computer db 0 jmp wboot ;In case user restarts the computer ***************************************************************** * * * Setsec just saves the desired sector to seek to until an * * actual read or write is attempted. * * * ***************************************************************** setsec: mov h,b ;Enter with sector number in (bc) mov l,c shld cpmsec donop: ret ***************************************************************** * * * Setdma saves the DMA address for the data transfer. * * * ***************************************************************** setdma: mov h,b ;Enter with DMA address in (bc) mov l,c shld cpmdma ;CP/M dma address ret ***************************************************************** * * * Home is translated into a seek to track zero. * * * ***************************************************************** home: lxi b,0 ;Track to seek to ***************************************************************** * * * Settrk saves the track # to seek to. Nothing is done at this * * point, everything is deffered until a read or write. * * * ***************************************************************** settrk: mov h,b ;Enter with track number in (bc) mov l,c shld cpmtrk ret ***************************************************************** * * * Sectran translates a logical sector number into a physical * * sector number. * * * ***************************************************************** sectran:lda cpmdrv ;Get the Drive Number mov h,a ;Drive in (h) mvi l,d.stran jmp jumper ;See device level sector translation routines ***************************************************************** * * * Setdrv selects the next drive to be used in read/write * * operations. If the drive has never been selected it calls * * a low level drive select routine that should perform some * * sort of check if the device is working. If not working then * * it should report an error. If the logical drive has been * * selected before then setdrv just returns the DPH without * * checking the drive. * * * ***************************************************************** setdrv: mov a,c ;Save the logical drive number sta cpmdrv cpi maxlog ;Check for a valid drive number jnc zret ;Illegal drive mov a,e ;Check if bit 0 of (e) = 1 ani 1 jnz setd3 ;Drive has allready been accessed. mov h,c ;Move logical drive into (h) mvi l,d.sel1 call jumper ;Call low level drive select mov a,h ;Check if the low level drive select returned ora l ; zero to indicate an error jz zret ;Yes, an error so report to CP/M push h ;Save DPH address call gdph ;Get entry if DPH save table pop d ;DPH -> (de) mov m,e ;Put address of DPH in table inx h mov m,d inx h mov m,c ;Put sector size in table inx h mov a,m ;Check if bad map has ever been read for this ora a ; drive cz getbad ;Never been read so read in bad map xchg ;DPH -> (hl) setd0: mov a,c ;Move sector size code into (a) sta secsiz ;Save sector size xra a setd1: dcr c ;Create number of (128 bytes/physical sector)-1 jz setd2 rlc ori 1 jmp setd1 setd2: sta secpsec ;Save for deblocking lda cpmdrv ;Save current drive as old drive sta lastdrv ; in case of select errors ret setd3: push d ;Save DPH address mov h,c ;Drive in (h) mvi l,d.sel2 ;Select drive call jumper call gdph ;Quick select pop d mov e,m ;DPH -> (de) inx h mov d,m inx h mov c,m ;Sector size -> (c) xchg ;DPH -> (hl) jmp setd0 gdph: lda cpmdrv ;Return pointer to DPH save area. rlc ;Each entry is 4 bytes long rlc mov e,a mvi d,0 lxi h,dphtab ;DPH save area table dad d ;Add offset ret ;(hl) = DPH save area for current drive zret: lxi h,0 ;Seldrv error exit lda lastdrv ;Get last selected drive mov c,a lda cdisk ;Pick up user/drive ani 0f0h ;Save user number ora c ;Put together with old drive sta cdisk ret ***************************************************************** * * * DPH save area. Each entry is 4 bytes long: * * 0 - LSB of DPH address * * 1 - MSB of DPH address * * 2 - Sector size code (1 = 128, 2 = 256, 3 = 512... * * 3 - Bad map has been initilized (0 = Uninitilized) * * * ***************************************************************** dphtab: rept maxlog*4 db 0 endm ***************************************************************** * * * Getbad - Check if a device has a bad map. If the device has * * a bad sector map then append bad entries to end of badmap * * table. * * * ***************************************************************** getbad: mvi m,1 ;Set drive initilized push b push d lda cpmdrv ;Pick up current drive mov h,a ;Call drive routine to return a pointer to mvi l,d.bad ;the track and sector of the bad map call jumper mov a,h ;If routine returns 0 then the device has ora l ; no bad sector map jz badret mov e,m ;Pick up track number of bad sector map -> (de) inx h mov d,m inx h xchg shld cpmtrk xchg mov a,m ;Pick up sector number of of bad sector map inx h mov h,m mov l,a shld truesec call fill ;Read in bad sector map into the buffer rc lhld badptr ;Pick up bad map pointer lxi d,buffer ;Start at beginning of buffer badl: ldax d ;Pick up an entry from the buffer ora a jz bade ;All done mov a,m ;Pick up entry from bad map table inr a jz overflo ;Bad map overflow lda cpmdrv ;Put drive in table mov m,a inx h lxi b,8 call movbyt ;Move the rest of information into the table jmp badl bade: shld badptr ;Restore new bad map pointer badret: pop d pop b ret overflo:lxi h,omes call message jmp badret omes: db 0dh, 0ah, 'BAD MAP OVERFLOW!', 0dh, 0ah, 0 nobad: lxi h,0 ;Used by device drives to indicate no bad ret ; sector map badptr: dw badmap ;Pointer to next available bad map entry ***************************************************************** * * * Write routine moves data from memory into the buffer. If the * * desired CP/M sector is not contained in the disk buffer, the * * buffer is first flushed to the disk if it has ever been * * written into, then a read is performed into the buffer to get * * the desired sector. Once the correct sector is in memory, the * * buffer written indicator is set, so the buffer will be * * flushed, then the data is transferred into the buffer. * * * ***************************************************************** write: mov a,c ;Save write command type sta writtyp mvi a,1 ;Set write command jmp rwent ***************************************************************** * * * Read routine to buffer data from the disk. If the sector * * requested from CP/M is in the buffer, then the data is simply * * transferred from the buffer to the desired dma address. If * * the buffer does not contain the desired sector, the buffer is * * flushed to the disk if it has ever been written into, then * * filled with the sector from the disk that contains the * * desired CP/M sector. * * * ***************************************************************** read: xra a ;Set the command type to read rwent: sta rdwr ;Save command type ***************************************************************** * * * Redwrt calculates the physical sector on the disk that * * contains the desired CP/M sector, then checks if it is the * * sector currently in the buffer. If no match is made, the * * buffer is flushed if necessary and the correct sector read * * from the disk. * * * ***************************************************************** redwrt: mvi b,0 ;The 0 is modified to contain the log2 secsiz equ $-1 ; of the physical sector size/128 ; on the currently selected disk. lhld cpmsec ;Get the desired CP/M sector # mov a,h ani 80h ;Save only the side bit mov c,a ;Remember the side mov a,h ani 7fh ;Forget the side bit mov h,a dcx h ;Temporary adjustment divloop:dcr b ;Update repeat count jz divdone ora a mov a,h rar mov h,a mov a,l rar ;Divide the CP/M sector # by the size ; of the physical sectors mov l,a jmp divloop ; divdone:inx h mov a,h ora c ;Restore the side bit mov h,a shld truesec ;Save the physical sector number lxi h,cpmdrv ;Pointer to desired drive,track, and sector lxi d,bufdrv ;Pointer to buffer drive,track, and sector mvi b,6 ;Count loop dtslop: dcr b ;Test if done with compare jz move ;Yes, match. Go move the data ldax d ;Get a byte to compare cmp m ;Test for match inx h ;Bump pointers to next data item inx d jz dtslop ;Match, continue testing ***************************************************************** * * * Drive, track, and sector don't match, flush the buffer if * * necessary and then refill. * * * ***************************************************************** call fill ;Fill the buffer with correct physical sector rc ;No good, return with error indication ***************************************************************** * * * Move has been modified to cause either a transfer into or out * * the buffer. * * * ***************************************************************** move: lda cpmsec ;Get the CP/M sector to transfer dcr a ;Adjust to proper sector in buffer ani 0 ;Strip off high ordered bits secpsec equ $-1 ;The 0 is modified to represent the # of ; CP/M sectors per physical sectors mov l,a ;Put into HL mvi h,0 dad h ;Form offset into buffer dad h dad h dad h dad h dad h dad h lxi d,buffer ;Beginning address of buffer dad d ;Form beginning address of sectgr to transfer xchg ;DE = address in buffer lxi h,0 ;Get DMA address, the 0 is modified t/ ; contain the DMA address cpmdma equ $-2 mvi a,0 ;The zero gets modified to contain ; a zero if a read, or a 1 if write rdwr equ $-1 ana a ;Test which kind of operation jnz into ;Transfer data into the buffer outof: call mov128 xra a ret into: xchg ; call mov128 ;Move the data, HL = destination ; DE = source mvi a,1 sta bufwrtn ;Set buffer written into flag mvi a,0 ;Check for directory write writtyp equ $-1 dcr a mvi a,0 sta writtyp ;Set no directory write rnz ;No error exit ***************************************************************** * * * Flush writes the contents of the buffer out to the disk if * * it has ever been written into. * * * ***************************************************************** flush: mvi a,0 ;The 0 is modified to reflect if ; the buffer has been written into bufwrtn equ $-1 ana a ;Test if written into rz ;Not written, all done mvi a,d.write sta rwop+1 ***************************************************************** * * * Prep prepares to read/write the disk. Retries are attempted. * * Upon entry, H&L must contain the read or write operation * * address. * * * ***************************************************************** prep: call alt ;Check for alternate sectors di ;Reset interrupts xra a ;Reset buffer written flag sta bufwrtn mvi b,retries ;Maximum number of retries to attempt retrylp:push b ;Save the retry count mvi l,d.sel2 ;Select drive call jumpbuf lhld alttrk ;Track number -> (hl) mov a,h ;Test for track zero ora l push h ;Save track number mvi l,d.home cz jumpbuf pop b ;Restore track # mvi l,d.strk call jumpbuf lhld altsec ;Sector -> (hl) mov b,h mov c,l mvi l,d.ssec call jumpbuf lxi b,buffer ;Set the DMA address mvi l,d.sdma call jumpbuf rwop: mvi l,0 ;Get operation address call jumpbuf pop b ;Restore the retry counter mvi a,0 ;No error exit status rnc ;Return no error dcr b ;Update the retry counter stc ;Assume retry count expired mvi a,0ffh ;Error return rz ;Return sad news mov a,b cpi retries/2 jnz retrylp ;Try again push b ;Save retry count mvi l,d.home ;Home drive after (retries/2) errors call jumpbuf pop b jmp retrylp ;Try again ***************************************************************** * * * Fill fills the buffer with a new sector from the disk. * * * ***************************************************************** fill: call flush ;Flush buffer first rc ;Check for error lxi d,cpmdrv ;Update the drive, track, and sector lxi h,bufdrv lxi b,5 ;Number of bytes to move call movbyt ;Copy the data lda rdwr ana a jz fread lda writtyp dcr a dcr a rz lda secsiz ;Check for 128 byte sectors dcr a rz fread: mvi a,d.read sta rwop+1 jmp prep ;Select drive, track, and sector. ; Then read the buffer ***************************************************************** * * * Jumpbuf, jumper are used to dispatch to a low level device * * subroutine. Jumper is called with the drive in (h) and the * * routine number (see description above) in (l). It passes * * along the (bc) and (de) registers unaltered. Jumpbuf is * * a call to jumper with the drive number from bufdrv. * * * ***************************************************************** jumpbuf:lda bufdrv ;Dispatch with bufdrv for drive mov h,a jumper: push d push b push h mov a,h ;Logical drive into (a) lxi d,dsttab ;Drive specification pointer table jumpl: mov c,a ;Save logical in (c) ldax d mov l,a inx d ldax d mov h,a ;Get a DST pointer in (hl) inx d mov a,c ;Logical in (a) sub m ;Subtract from first entry in DST jnc jumpl ;Keep scanning table till correct driver found inx h ;Bump (hl) to point to start of dispatch table pop d ;Real (hl) -> (de) mov a,e ;Move offset number into (a) rlc ;Each entry is 2 bytes mov e,a ;Make an offset mvi d,0 dad d ;(hl) = **Routine mov a,m ;Pick up address of handler for selected inx h ; function. mov h,m mov l,a ;(hl) = *routine mov a,c ;Logical in (a) pop b ;Restore saved registers pop d pchl ***************************************************************** * * * Check for alternate sectors in bad sector table. If an * * alternate sector is found replace alttrk and altsec with * * new sector number else pass along unaltered. * * * ***************************************************************** alt: lxi h,badmap ;Address of bad map -> (hl) lda bufdrv ;Pick up drive number currently working on mov c,a ;Move drive into (c) for speed in search all: xchg lhld badptr ;Get bad map pointer xchg ; -> (de) mov a,d ;Check if at end of bad map table cmp h jnz alt2 ;Still more mov a,e cmp l jnz alt2 ;Still more lhld buftrk ;No alternate sector so use selected sector shld alttrk lhld bufsec shld altsec ret alt2: push h ;Save current bad map entry address mov a,c ;Move drive into (a) cmp m ;Check if drive in table matches jnz altmis ;Does not match skip this entry inx h ;Point to LSB of alternate track lda buftrk ;Pick up LSB of buffer track cmp m jnz altmis inx h ;Point to MSB alternate track lda buftrk+1 ;Pick up MSB of buffer track cmp m jnz altmis inx h ;Point to LSB of alternate sector lda bufsec ;Pick up LSB of buffer sector cmp m jnz altmis inx h ;Point to MSB of alternate sector lda bufsec+1 ;Pick up MSB of buffer sector cmp m jnz altmis ;Found an alternate sector inx h ;Point to real info on the alternate sector lxi d,alttrk xchg ;MOVLOP (de) = source, (hl) = dest push b lxi b,4 call movbyt ;Move alternate sector info in correct place pop b pop h ret altmis: pop h ;Current alternate did not match lxi d,9 ;Bump pointer by the length of an entry dad d jmp all ;Loop for more ***************************************************************** * * * Mover moves 128 bytes of data. Source pointer in DE, Dest * * pointer in HL. * * * ***************************************************************** mov128: lxi b,128 ;Length of transfer movbyt: xra a ;Check if host processor is a Z80 adi 3 jpo z80mov ;Yes, Its a Z80 so use block move m8080: ldax d ;Get a byte of source mov m,a ;Move it inx d ;Bump pointers inx h dcx b ;Update counter mov a,b ;Test for end ora c jnz m8080 ret z80mov: xchg ;Source in (hl), Destination in (de) dw 0b0edh ;ldir xchg ret ***************************************************************** * * * Return DPH pointer. Enter with (de) with DPH base address * * and (a) with logical drive number. Returns with DPH address * * in (hl). * * * ***************************************************************** retdph mov l,a ;Move logical drive into (l) mvi h,0 dad h ;Multiply by 16 (size of DPH) dad h dad h dad h dad d ;(hl) = pointer to DPH ret ***************************************************************** * * * Utility routine to output the message pointed at by (hl) * * terminated with a null. * * * ***************************************************************** message:mov a,m ;Get a character of the message inx h ;Bump text pointer ora a ;Test for end rz ;Return if done push h ;Save pointer to text mov c,a ;Output character in C call cout ;Output the character pop h ;Restore the pointer jmp message ;Continue until null reached ***************************************************************** * * * The following equates are for the Diskus Hard disk * * * ***************************************************************** if hdc3 ne 0 ;Want HDC3 controller included ? hdorg equ 50h ;Hard Disk Controller origin hdstat equ hdorg ;Hard Disk Status hdcntl equ hdorg ;Hard Disk Control hdcmnd equ hdorg+1 ;Hard Disk Command hdreslt equ hdorg+1 ;Hard Disk Result hdfunc equ hdorg+2 ;Hard Disk Function hddata equ hdorg+3 ;Hard Disk Data retry equ 2 ;Retry bit of result tkzero equ 01h ;Track zero bit of status opdone equ 02h ;Operaction done bit of status complt equ 04h ;Complete bit of status tmout equ 08h ;Time out bit of status wfault equ 10h ;Write fault bit of status drvrdy equ 20h ;Drive ready bit of status index equ 40h ;Index bit of status pstep equ 4 ;Step bit of function nstep equ 0fbh ;Step bit mask of function hdrlen equ 4 ;Sector header length seclen equ 512 ;Sector data length wenabl equ 0fh ;Write enable wreset equ 0bh ;Write reset of function scenbl equ 5 ;Controller control dskclk equ 7 ;Disk clock for control mdir equ 0f7h ;Direction mask for function null equ 0fch ;Null command idbuff equ 0 ;Initialize data command rsect equ 1 ;Read sector command wsect equ 5 ;Write sector command isbuff equ 8 ;Initialize header command ***************************************************************** * * * Device Specification Table for HDC3 * * * ***************************************************************** hddst: db maxhd*hdlog ;Number of logical drives dw hdwarm ;Warm boot dw hdtran ;Sector translation dw hdldrv ;Select logical drive 1 (First time select) dw hddrv ;Select logical drive 2 (General sel ect) dw hdhome ;Home current selected drive dw hdseek ;Seek to selected track dw hdsec ;Select sector dw hddma ;Set DMA address dw hdread ;Read a sector dw hdwrite ;Write a sector dw nobad ;No bad sector map hdwarm: call divlog ;Get physical drive number in (c) xra a lxi h,ccp-200h ;Initial DMA address push h sta head ;Select head zero inr a ; 1 -> (a) push psw ;Save first sector - 1 call hdd2 ;Select drive mvi c,0 call hdhome ;Home the drive hdwrld: pop psw ;Restore sector pop h ;Restore DMA address inr a sta hdsectr cpi 12 ;Past BDOS ? rz ;Yes, all done inr h ;Update DMA address inr h shld hdadd push h push psw hdwrrd: lxi b,retries*100h+0;Retry counter hdwr: push b ;Save the retry count call hdread ;Read the sector pop b jnc hdwrld ;Test for error dcr b ;Update the error count jnz hdwr ;Keep trying if not to many errors stc ;Error flag ret hdtran: mov h,b mov l,c inx h ret hdldrv: sta hdcur ;Save logical disk call divlog ;Divide by logical disks per drive mov a,c sta hddisk ;Save new physical drive call hdptr ;Get track pointers mov a,m ;Get current track inr a ;Check if -1 jnz hdl2 ;Nope, allready accessed ori null ;Select drive out hdfunc mvi a,scenbl ;Enable the controller out hdcntl mvi c,239 ;Wait approx 2 minutes for Disk to ready lxi h,0 hdtdel: dcx h mov a,h ora l cz dcrc jz zret ;Drive not ready error in hdstat ;Test if ready yet ani drvrdy jnz hdtdel if not fujitsu lxi h,0 ;Time one revolution of the drive mvi c,index in hdstat ana c mov b,a ;Save current index level in B hdinxd1:in hdstat ana c cmp b ;Loop util index level changes jz hdinxd1 hdindx2:inx h in hdstat ;Start counting until index returns to ana c ; previous state cmp b jnz hdindx2 if m10 ;Memorex M10's have 40 ms head settle dad h endif if m26 ;Shugart M26's have 30 ms head settle xra a mov a,h rar mov d,a mov a,l rar mov e,a dad d endif shld settle ;Save the Count for timeout delay endif call hdhome hdl2: lda hdcur ;Load logical drive lxi d,dphhd0 ;Start of hard disk DPH's mvi c,3 ;Hard disk sector size equals 512 bytes jmp retdph dcrc: dcr c ;Conditional decrement C routine ret divlog: mvi c,0 divlx: sui hdlog rc inr c jmp divlx hddrv: sta hdcur call divlog ;Get the physical drive # hdd2: mov a,c sta hddisk ;Select the drive ori null out hdfunc mvi a,wenabl out hdcntl ret hdhome: call hdptr mvi m,0 ;Set track to zero in hdstat ;Test status ani tkzero ;At track zero ? rz ;Yes if not fujitsu hdstepo:in hdstat ;Test status ani tkzero ;At track zero ? jz hddelay mvi a,1 stc call accok ;Take one step out jmp hdstepo else xra a jmp accok endif if not fujitsu hddelay:lxi h,0 ;Get hddelay settle equ $-2 deloop: dcx h ;Wait 20ms mov a,h ora l inx h dcx h jnz deloop ret endif hdseek: call hdptr ;Get pointer to current track mov e,m ;Get current track mov m,c ;Update the track mov a,e ;Need to seek at all ? sub c rz cmc ;Get carry into direction jc hdtrk2 cma inr a if fujitsu hdtrk2: jmp accok else hdtrk2: call accok jmp hddelay endif accok: mov b,a ;Prep for build call build sloop: ani nstep ;Get step pulse low out hdfunc ;Output low step line ori pstep ;Set step line high out hdfunc ;Output high step line dcr b ;Update repeat count jnz sloop ;Keep going the required # of tracks jmp wsdone hddma: mov h,b ;Save the DMA address mov l,c shld hdadd ret wsdone: in hdstat ;Wait for seek complete to finish ani complt jz wsdone ret if m26 hdsec: mvi a,01fh ;For compatibility with Cbios rev 2.3, 2.4 ana c cz getspt sta hdsectr mvi a,0e0h ana c rlc rlc rlc sta head getspt: mvi a,hdspt ret else hdsec: mov a,c call divspt adi hdspt ana a cz getspt sta hdsectr mov a,c sta head getspt: mvi a,hdspt dcr c ret divspt: mvi c,0 divsx: sui hdspt rc inr c jmp divsx endif hdread: call hdprep rc xra a out hdcmnd cma out hddata out hddata mvi a,rsect ;Read sector command out hdcmnd call process rc xra a out hdcmnd mvi b,seclen/4 lxi h,0 hdadd equ $-2 in hddata in hddata rtloop: in hddata ;Move four bytes mov m,a inx h in hddata mov m,a inx h in hddata mov m,a inx h in hddata mov m,a inx h dcr b jnz rtloop ret hdwrite:call hdprep ;Prepare header rc xra a out hdcmnd lhld hdadd mvi b,seclen/4 wtloop: mov a,m ;Move 4 bytes out hddata inx h mov a,m out hddata inx h mov a,m out hddata inx h mov a,m out hddata inx h dcr b jnz wtloop mvi a,wsect ;Issue write sector command out hdcmnd call process rc mvi a,wfault ana b stc rz xra a ret process:in hdstat ;Wait for command to finish mov b,a ani opdone jz process mvi a,dskclk out hdcntl in hdstat ani tmout ;Timed out ? stc rnz in hdreslt ani retry ;Any retries ? stc rnz xra a ret hdprep: in hdstat ani drvrdy stc rnz mvi a,isbuff ;Initialize pointer out hdcmnd call build ori 0ch out hdfunc lda head out hddata ;Form head byte call hdptr mov a,m ;Form track byte out hddata ana a mvi b,80h jz zkey mvi b,0 zkey: mvi a,0 ;Form sector byte hdsectr equ $-1 out hddata mov a,b out hddata mvi a,dskclk out hdcntl mvi a,wenabl out hdcntl xra a ret hdptr: lhld hddisk xchg mvi d,0 lxi h,drives dad d ret build: mvi a,0 head equ $-1 ral ral ral ral ori 0 hddisk equ $-1 xri 0f0h ret drives equ $ rept maxhd db 0ffh endm hdcur: db 0 ;Current logical disk endif ***************************************************************** * * * The following equates relate the Morrow Designs 2D/B * * controller. If the controller is non standard (0F800H) * * only the FDORIG equate need be changed. * * * ***************************************************************** if maxfd ne 0 ;Include Discus 2D ? fdorig equ 0f800H ;Origin of Disk Jockey PROM fdboot equ fdorig+00h ;Disk Jockey 2D initialization fdcin equ fdorig+03h ;Disk Jockey 2D character input routine fdcout equ fdorig+06h ;Disk Jockey 2D character output routine fdhome equ fdorig+09h ;Disk Jockey 2D track zero seek fdseek equ fdorig+0ch ;Disk Jockey 2D track seek routine fdsec equ fdorig+0fh ;Disk Jockey 2D set sector routine fddma equ fdorig+12h ;Disk Jockey 2D set DMA address fdread equ fdorig+15h ;Disk Jockey 2D read routine fdwrite equ fdorig+18h ;Disk Jockey 2D write routine fdsel equ fdorig+1bh ;Disk Jockey 2D select drive routine fdtstat equ fdorig+21h ;Disk Jockey 2D terminal status routine fdstat equ fdorig+27h ;Disk Jockey 2D status routine fderr equ fdorig+2ah ;Disk Jockey 2D error, flash led fdden equ fdorig+2dh ;Disk Jockey 2D set density routine fdside equ fdorig+30h ;Disk Jockey 2D set side routine fdram equ fdorig+400h ;Disk Jockey 2D RAM address dblsid equ 20h ;Side bit from controller io equ fdorig+3f8h ;Start of I/O registers dreg equ io+1 cmdreg equ io+4 clrcmd equ 0d0h ***************************************************************** * * * Device Specification Table for the Disk Jockey 2D/B * * * ***************************************************************** fddst: db maxfd ;Number of logical drives dw fdwarm ;Warm boot dw fdtran ;Sector translation dw fdldrv ;Select drive 1 dw fdsel2 ;Select drive 2 dw fdlhome ;Home drive dw fdseek ;Seek to specified track dw fdssec ;Set sector dw fddma ;Set DMA address dw fdread ;Read a sector dw fdwrite ;Write a sector dw nobad ;No bad sector map ***************************************************************** * * * Floppy disk warm boot loader * * * ***************************************************************** fdwarm: mov c,a call fdsel ;Select drive A mvi c,0 ;Select side 0 call fdside wrmfail:call fdhome ;Track 0, single density jc wrmfail ;Loop if error ;The next block of code re-initializes ; the warm boot loader for track 0. mvi a,5-2 ;Initialize the sector to read - 2 sta newsec lxi h,ccp-100h ;First revolution DMA - 100h shld newdma ;Load all of track 0 t0boot: mvi a,5-2 ;First sector - 2 newsec equ $-1 inr a ;Update sector # inr a cpi 27 ;Size of track in sectors + 1 jc nowrap ;Skip if not at end of track jnz t1boot ;Done with this track sui 27-6 ;Back up to sector 6 lxi h,ccp-80h ;Memory address of sector - 100h shld newdma nowrap: sta newsec ;Save the updated sector # mov c,a call fdsec ;Set up the sector lxi h,ccp-100h ;Memory address of sector - 100h newdma equ $-2 lxi d,100h ;Update DMA address dad d nowrp: shld newdma ;Save the updated DMA address mov b,h mov c,l call fddma ;Set up the new DMA address lxi b,retries*100h+0;Maximum # of errors, track # wrmfred:push b call fdseek ;Set up the proper track call fdread ;Read the sector pop b jnc t0boot ;Continue if no error dcr b jnz wrmfred ;Keep trying if error jmp fderr ;Too many errors, flash the light ;Load track 1, sector 1, sector 3 (partial), sector 2 (1024 byte sectors) t1boot: mvi c,1 ;Track 1 call fdseek lxi b,ccp+0b00h ;Address for sector 1 lxi d,10*100h+1 ;Retry count + sector 1 call wrmread lxi b,ccp+0f00h ;Address for sector 2 lxi d,10*100h+3 ;Retry count + sector 3 call wrmread lxi b,0300h ;Size of partial sector lxi d,ccp+1300h ;Address for sector 3 lxi h,ccp+0f00h ;Address of sector 3 wrmcpy: mov a,m ;Get a byte and stax d ; save it. inx d ;Bump pointers inx h dcx b ;Bump counter mov a,b ;Check if done ora c jnz wrmcpy ; if not, loop lxi b,ccp+0f00h ;Address for sector 2 lxi d,10*100h+2 ;Retry count + sector 2 call wrmread xra a ;Clear error indicator ret wrmread:push d call fddma ;Set DMA address pop b call fdsec ;Set sector wrmfrd: push b ;Save error count call fdread ;Read a sector jc wrmerr ;Do retry stuff on error call fdstat ;Sector size must be 1024 bytes ani 0ch ;Mask length bits sui 0ch ;Carry (error) will be set if < 0c0h wrmerr: pop b ;Fetch retry count rnc ;Return if no error dcr b ;Bump error count jnz wrmfrd jmp fderr ;Error, flash the light fdtran: inx b push d ;Save table address push b ;Save sector # call fdget ;Get DPH for current drive lxi d,10 ;Load DPH pointer dad d mov a,m inx h mov h,m mov l,a mov a,m ;Get # of CP/M sectors/track ora a ;Clear carry rar ;Divide by two sub c ;Subtract sector number push psw ;Save adjusted sector jm sidetwo sidea: pop psw ;Discard adjusted sector pop b ;Restore sector requested pop d ;Restore address of xlt table sideone:xchg ;hl <- &(translation table) dad b ;bc = offset into table mov l,m ;hl <- physical sector mvi h,0 ret sidetwo:call fdgsid ;Check out number of sides jz sidea ;Single sided pop psw ;Retrieve adjusted sector pop b cma ;Make sector request positive inr a mov c,a ;Make new sector the requested sector pop d call sideone mvi a,80h ;Side two bit ora h ; and sector mov h,a ret fdldrv: sta fdlog ;Save logical drive mov c,a ;Save drive # mvi a,0 ;Have the floppies been accessed yet ? flopflg equ $-1 ana a jnz flopok mvi b,17 ;Floppies havn't been accessed lxi h,fdboot ;Check if 2D controller is installed mvi a,(jmp) clopp: cmp m ;Must have 17 jumps jnz zret inx h inx h inx h dcr b jnz clopp lxi d,fdinit ;Initialization sequence lxi h,fdorig+7e2h ;Load address lxi b,30 ;Byte count call movbyt ;Load controller RAM mvi a,0ffh ;Start 1791 sta dreg mvi a,clrcmd ;1791 reset sta cmdreg mvi a,1 ;Set 2D initialized flag sta flopflg flopok: call flush ;Flush buffer since we are using it lda fdlog ;Select new drive mov c,a call fdsel call fdlhome ;Recalibrate the drive lxi h,1 ;Select sector 1 of track 2 shld truesec inx h shld cpmtrk xra a ;Make sure we are doing a read sta rdwr call fill ;Fill in buffer with sector jc zret ;Test for error return call fdstat ;Get status on current drive sta fdldst ;Save drive status ani 0ch ;Mask in sector size bits push psw ;Used to select a DPB rar lxi h,xlts ;Table of XLT addresses mov e,a mvi d,0 dad d push h ;Save pointer to proper XLT call fdget ;Get pointer to proper DPH pop d lxi b,2 ;Copy XLT pointer into DPH call movbyt lxi d,8 ;Offset to DPB pointer in DPH dad d ;HL <- &DPH.DPB push h call fdgsid ;Get pointer to side flag table entry lda fdldst ;Get drive status ani dblsid ;Check double sided bit mov m,a ;Save sides flag lxi d,dpb128s ;Base for single sided DPB's jz sideok lxi d,dpb128d ;Base of double sided DPB's sideok: xchg pop d ;(HL) -> DPB base, (DE) -> &DPH.DPB pop psw ;Offset to correct DPB ral ral ;Make 0, 10, 20, 30 mov c,a mvi b,0 ;Make offset dad b ;(hl) is now a DPB pointer xchg ;Put proper DPB address in DPH.DPB mov m,e inx h mov m,d lxi h,15 ;Offset to DPB.SIZ dad d mov c,m ;Fetch sector size code fdget: lda fdlog ;Return proper DPH lxi d,dphfd0 jmp retdph fdsel2: sta fdlog mov c,a jmp fdsel fdlhome:mvi c,0 ;Select side 0 call fdside jmp fdhome ;Do actual home fdssec: push b ;Save sector number mov a,b ;Check side select bit rlc ;Move high bit to bit zero ani 1 mov c,a call fdside ;Call select side 0 = side A, 1 = Side B pop b jmp fdsec fdgsid: lxi h,fdlsid ;Side flag table lda fdlog ;Drive number push d mov e,a ;Make offset mvi d,0 dad d ;Offset to proper entry pop d mov a,m ;Set up flags ora a ret fdinit: dw 0 ;Initialization bytes loaded onto 2D/B dw 1800h ;Head loaded timeout dw 0 ;DMA address db 0 ;Double sided flag db 0 ;Read header flag db 07eh ;Drive select constant db 0 ;Drive number db 8 ;Current disk db 0 ;Head loaded flag db 9 ;Drive 0 parameters db 0ffh ;Drive 0 track address db 9 ;Drive 1 parameters db 0ffh ;Drive 1 track address db 9 ;Drive 2 parameters db 0ffh ;Drive 2 track address db 9 ;Drive 3 parameters db 0ffh ;Drive 3 track address db 9 ;Current parameters db 0 ;Side desired db 1 ;Sector desired db 0 ;Track desired db 0 ;Header image, track db 0 ;Sector db 0 ;Side db 0 ;Sector dw 0 ;CRC fdlog: db 0 fdldst: db 0 ;Floppy drive status byte fdlsid: rept maxfd db 0ffh ;Double sided flag 0 = single, 1 = double endm endif if (maxfd ne 0) or (maxdm ne 0) ***************************************************************** * * * Xlts is a table of address that point to each of the xlt * * tables for each sector size. * * * ***************************************************************** xlts: dw xlt128 ;Xlt for 128 byte sectors dw xlt256 ;Xlt for 256 byte sectors dw xlt512 ;Xlt for 512 byte sectors dw xlt124 ;Xlt for 1024 byte sectors ***************************************************************** * * * Xlt tables (sector skew tables) for CP/M 2.0. These tables * * define the sector translation that occurs when mapping CP/M * * sectors to physical sectors on the disk. There is one skew * * table for each of the possible sector sizes. Currently the * * tables are located on track 0 sectors 6 and 8. They are * * loaded into memory in the Cbios ram by the cold boot routine. * * * ***************************************************************** xlt128: db 0 db 1,7,13,19,25 db 5,11,17,23 db 3,9,15,21 db 2,8,14,20,26 db 6,12,18,24 db 4,10,16,22 xlt256: db 0 db 1,2,19,20,37,38 db 3,4,21,22,39,40 db 5,6,23,24,41,42 db 7,8,25,26,43,44 db 9,10,27,28,45,46 db 11,12,29,30,47,48 db 13,14,31,32,49,50 db 15,16,33,34,51,52 db 17,18,35,36 xlt512: db 0 db 1,2,3,4,17,18,19,20 db 33,34,35,36,49,50,51,52 db 5,6,7,8,21,22,23,24 db 37,38,39,40,53,54,55,56 db 9,10,11,12,25,26,27,28 db 41,42,43,44,57,58,59,60 db 13,14,15,16,29,30,31,32 db 45,46,47,48 xlt124: db 0 db 1,2,3,4,5,6,7,8 db 25,26,27,28,29,30,31,32 db 49,50,51,52,53,54,55,56 db 9,10,11,12,13,14,15,16 db 33,34,35,36,37,38,39,40 db 57,58,59,60,61,62,63,64 db 17,18,19,20,21,22,23,24 db 41,42,43,44,45,46,47,48 ***************************************************************** * * * Each of the following tables describes a diskette with the * * specified characteristics. * * * ***************************************************************** ***************************************************************** * * * The following DPB defines a diskette for 128 byte sectors, * * single density, and single sided. * * * ***************************************************************** dpb128s:dw 26 ;CP/M sectors/track db 3 ;BSH db 7 ;BLM db 0 ;EXM dw 242 ;DSM dw 63 ;DRM db 0c0h ;AL0 db 0 ;AL1 dw 16 ;CKS dw 2 ;OFF db 1 ***************************************************************** * * * The following DPB defines a diskette for 256 byte sectors, * * double density, and single sided. * * * ***************************************************************** dpb256s:dw 52 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 242 ;DSM dw 127 ;DRM db 0c0h ;AL0 db 0 ;AL1 dw 32 ;CKS dw 2 ;OFF db 2 ***************************************************************** * * * The following DPB defines a diskette as 512 byte sectors, * * double density, and single sided. * * * ***************************************************************** dpb512s:dw 60 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 280 ;DSM dw 127 ;DRM db 0c0h ;AL0 db 0 ;AL1 dw 32 ;CKS dw 2 ;OFF db 3 ***************************************************************** * * * The following DPB defines a diskette as 1024 byte sectors, * * double density, and single sided. * * * ***************************************************************** dp1024s:dw 64 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 299 ;DSM dw 127 ;DRM db 0c0h ;AL0 db 0 ;AL1 dw 32 ;CKS dw 2 ;OFF db 4 ***************************************************************** * * * The following DPB defines a diskette for 128 byte sectors, * * single density, and double sided. * * * ***************************************************************** dpb128d:dw 52 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 1 ;EXM dw 242 ;DSM dw 127 ;DRM db 0c0h ;AL0 db 0 ;AL1 dw 32 ;CKS dw 2 ;OFF db 1 ***************************************************************** * * * The following DPB defines a diskette as 256 byte sectors, * * double density, and double sided. * * * ***************************************************************** dpb256d:dw 104 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 486 ;DSM dw 255 ;DRM db 0f0h ;AL0 db 0 ;AL1 dw 64 ;CKS dw 2 ;OFF db 2 ***************************************************************** * * * The following DPB defines a diskette as 512 byte sectors, * * double density, and double sided. * * * ***************************************************************** dpb512d:dw 120 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 561 ;DSM dw 255 ;DRM db 0f0h ;AL0 db 0 ;AL1 dw 64 ;CKS dw 2 ;OFF db 3 ***************************************************************** * * * The following DPB defines a diskette as 1024 byte sectors, * * double density, and double sided. * * * ***************************************************************** dp1024d:dw 128 ;CP/M sectors/track db 4 ;BSH db 15 ;BLM db 0 ;EXM dw 599 ;DSM dw 255 ;DRM db 0f0h ;AL0 db 0 ;AL1 dw 64 ;CKS dw 2 ;OFF db 4 endif ***************************************************************** * * * The following equates relate the Morrow Designs DJDMA * * controller. * * * ***************************************************************** if (maxdm ne 0) or (maxmf ne 0) dmchan equ 50h ;Default channel address dmkick equ 0efh ;Kick I/O port address rdsect equ 20h ;Read sector command wrsect equ 21h ;Write a sector command gstat equ 22h ;Get drive status dmsdma equ 23h ;Set DMA address intrqc equ 24h ;Set Interrupt request haltc equ 25h ;Halt command bracha equ 26h ;Channel branch setcha equ 27h ;Set channel address setcrc equ 28h ;Set CRC retry count rdtrck equ 29h ;Read track command wrtrck equ 2ah ;Write track command serout equ 2bh ;Serial ouput through bit banger serial port senabl equ 2ch ;Enable serial input trksiz equ 2dh ;Set number of tracks setlog equ 2eh ;Set logical drives readm equ 0a0h ;Read from controller memory writem equ 0a1h ;Write to controller memory n.dubl equ 80h ;Double density n.2side equ 40h ;2 sided drive serin equ 03eh ;Address of serial input data, (status - 1) ***************************************************************** * * * Device Specification Table for the Disk Jockey DMA floppy * * * ***************************************************************** if maxdm ne 0 dmdst: db maxdm ;Number of logical drives dw dmwarm ;Warm boot dw dmtran ;Sector translation dw dmldrv ;Select drive 1 dw dmselr ;Select drive 2 dw dmhome ;Home drive dw dmseek ;Seek to specified track dw dmssec ;Set sector dw dmdma ;Set DMA address dw dmread ;Read a sector dw dmwrite ;Write a sector dw nobad ;No bad sector map dmtrck equ 22*128 ;Amount of code on track 0 dmwarm: call dmselr ;Select drive 0 lxi h,dmchan ;Set up branch mvi m,bracha inx h mvi m,(dmwchn and 0ffh) ;Low address byte inx h mvi m,(dmwchn / 0100h) ;High address byte inx h mvi m,0 dmwbad: lxi h,dmwend-1 ;Pointer to end of command structure call docmd ;Read in tracks lda dmwst ;Get track read status ani 40h jz dmwbad ;Loop on 'terrible' errors like no disk lxi b,300h ;3/4 K bytes of sector 3 needs to be moved lxi d,buffer ;Sector 3 is in our buffer lxi h,ccp+1300h ; and this is where we want it to go... call movbyt xra a ret dmwchn: db dmsdma ;Set track 0 DMA address dw ccp-512 ;First track DMA address - boot loader db 0 db rdtrck ;Read track command db 0 ;Track 0 db 0 ;Side 0 db 0 ;Drive 0 dw dmwsec ;Sector load/status map db 0 dmwst: db 0 ;Track read status db dmsdma dw ccp+dmtrck ;DMA address for track 1 db 0 db rdtrck db 1 ;Track 1 db 0 ;Side 0 db 0 ;Drive 0 dw dmwsec+26 ;Map is loaded right after track 0 status map db 0 db 0 ;Track read status db dmsdma dw buffer ;Sector 3 gets loaded in system buffer db 0 db rdsect db 1 ;Track 1 db 3 ;Side 0, sector 3 db 0 ;Drive 0 dmwend: db 0 ;Read status dw 0 ;Room for the halt dmwsec: dw 0ffffh, 0ffffh ;Do not load boot loader dw 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ;22 sectors to be loaded dw 0, 0ffffh, 0ffffh, 0ffffh ;First 2 sectors on track 2 dmselr: sta dmlog mvi b,0 ;8 inch logical drives start at zero jmp dmsel2 dmtran: inx b push d ;Save table address push b ;Save sector # call dmget lxi d,10 dad d mov a,m inx h mov h,m mov l,a mov a,m ;Get # of CP/M sectors/track ora a ;Clear cary rar ;Divide by two sub c push psw ;Save adjusted sector jm dmside2 dmsidea:pop psw ;Discard adjusted sector pop b ;Restore sector requested pop d ;Restor address of xlt table dmside1:xchg ;hl <- &(translation table) dad b ;bc = offset into table mov l,m ;hl <- physical sector mvi h,0 ret dmside2:call dmstat ani 20h jz dmsidea pop psw ;Retrieve adjusted sector pop b cma ;Make sector request positive inr a mov c,a ;Make new sector the requested sector pop d call dmside1 mvi a,80h ;Side two bit ora h ; and sector mov h,a ret dmldrv: sta dmlog call dminit ;Test for a drive jc zret lxi h,1 ;Select sector 1 of track 2 shld truesec inx h shld cpmtrk xra a ;Make sure we are doing a read sta rdwr call fill ;Flush buffer and refill jc zret ;Test for error return call dmstat ;Get status on current drive ani 0ch ;Mask in sector size bits push psw ;Used to select a DPB rar lxi h,xlts ;Table of XLT addresses mov e,a mvi d,0 dad d push h ;Save pointer to proper XLT call dmget pop d lxi b,2 ;Number of bytes to move call movbyt ;Move the address of XLT lxi d,8 ;Offset to DPB pointer dad d ;HL <- &DPH.DPB push h call dmstat ani 20h ;Check double sided bit lxi d,dpb128s ;Base for single sided DPB's jz dmsok lxi d,dpb128d ;Base of double sided DPB's call sethigh ;Set controller to know about fast steping dmsok: xchg ;HL <- DBP base, DE <- &DPH.DPB pop d ;Restore DE (pointer into DPH) pop psw ;Offset to correct DPB ral ral mov c,a mvi b,0 dad b xchg ;Put DPB address in DPH mov m,e inx h mov m,d lxi h,15 dad d mov c,m dmget: lda dmlog lxi d,dphdm0 jmp retdph sethi: db writem ;Write to controller memory dw stephi ;Point to step rate for fast stepping db 0 ;Extended address 0 dw 2 ;Move two bytes to controller add0: dw 0 ;This address is patched from below to point ;to the drive table for new selected drive db writem ;Write to controller memory dw settlhi db 0 dw 2 add1: dw 0 dmend: db haltc ;Halt command db 0 ;Status stephi: dw 066h ;3 MS track to track step rate settlhi:dw 200h ;15 MS head settle delay sethigh:push d lxi h,1340h ;Pointer to start of Drive Paramter Table in ; DJDMA lxi d,10h ;Size of SPT table lda dmlog seth0: ora a ;Still more tables to skip jz seth1 dad d ;Offset to next table dcr a jmp seth0 seth1: xchg ;Move pointer to DPT in (de) lxi h,4 dad d shld add0 ;Address of step delay lxi h,10 dad d shld add1 ;Address of head settle delay lxi h,dmchan mvi m,bracha inx h mvi m,sethi and 0ffh inx h mvi m,(sethi/100h) and 0ffh inx h mvi m,0 ;Extended address 0 lxi h,dmend-1 xra a call docmd2 pop d ret endif ***************************************************************** * * * Drive specification table for DJDMA 5 1/4 inch drives * * * ***************************************************************** if maxmf ne 0 mfdst: db maxmf ;Number of logical drives dw mfwarm ;Warm boot dw mftran ;Sector translation dw mfldrv ;Select drive 1 dw mfsel2 ;Select drive 2 dw dmhome ;Home drive dw mfseek ;Seek to specified track dw mfssec ;Set sector dw dmdma ;Set DMA address dw dmread ;Read a sector dw dmwrite ;Write a sector dw nobad ;No bad sector map mftrck equ 9*512 ;Amount of code on track 0 mfwarm: call mfsel2 ;Select drive 0 lxi h,dmchan ;Set up branch mvi m,bracha inx h mvi m,(mfwchn and 0ffh) ;Low address byte inx h mvi m,(mfwchn / 0100h) ;High address byte inx h mvi m,0 mfwfal: lxi h,mfwend-1 ;Pointer to end of command structure calì docmä ;Reaä iî tracks lda mfwst ;Check out drive status ani 40h ;Test for ok jz mfwfal ;Failed, loop xra a ;Return no error ret mfwchn: db dmsdma ;Set track 0 DMA address dw ccp-512 ;First track DMA address - boot loader db 0 db rdtrck ;Read track command db 0 ;Track 0 db 0 ;Side 0 db 0 ;Drive 0 dw mfwsec ;Sector load/status map db 0 mfwst db 0 ;Track read status db dmsdma dw ccp+mftrck ;DMA address for track 1 db 0 db rdtrck db 1 ;Track 1 db 0 ;Side 0 db 0 ;Drive 0 dw mfwsec+10 ;Map is loaded right after track 0 status map db 0 mfwend: db 0 ;Track read status dw 0 ;Room for the halt mfwsec: dw 0ffh, 0, 0, 0, 0 ;Do not load boot loader dw 0, 0ffffh, 0ffffh, 0ffffh, 0ffffh ;first two sectors loaded mfssec: dcr c ;Minnie floppy sectors start at zero lda dblflg ;Get double sided flags ora a jz dmssec ;Nope, single sided mvi b,80h ;Set high bit for double sided select jmp dmssec dblflg: db 0 mfseek: xra a ;Clear double sided select sta dblflg lda mfcon ani n.2side jz dmseek ;Only siingle sided mov a,c ;Move selected track in (a) sbi 35 ;Subtract by track by number of tracks jc dmseek ;Less than track 35 mov d,a ;Save adjusted track number mvi a,34 sub d ;Adjust to count tracks back out mov c,a ;Resave new track number mvi a,0ffh ;Set double sided flag sta dblflg jmp dmseek mfsel2: sta mflog mvi b,4 ;5 1/4 inch drives start at drive 4 jmp dmsel2 mftran: inr c ;Increment Sector number lda mfcon ani n.dubl lxi h,mfxltd-1 ;Point to double sided sector translation table jnz mftdubl ;Single density sector translation lxi h,mfxlts-1 mftdubl:dad b ;Add offset sector number to table mov l,m ;Pick up sector number from table mvi h,0 ;MSB of sector number equal 0 ret mfldrv: sta mflog call dminit ;Test for a controller jc zret mvi a,n.dubl sta mfcon lxi h,1 ;Select sector 1 of track 0 shld truesec dcx h shld cpmtrk xra a ;Make sure we are doing a read sta rdwr call fill ;Flush buffer and refill jc zret ;Test for error return lda buffer+5ch ;Get diskette configuration byte push psw ;Save configuration byte lxi h,1 shld cpmtrk ;Load track 1 sector 1 call fill ;This is to fix bug with DJDMA firmware on jc zret ; returning single density status on track 0 pop psw ora a jnz mfl9 ;Non zero mvi a,90h ;Double density default configuration call dmstat ;If zero then determine sector size ani 80h ;Check density bit jnz mfl9 ;Its double density mvi a,10h ;Single density default configuration byte mfl9: mov c,a ;Move configuration byte into (c) lxi h,mfs ;Address of configuration table -> (hl) mfl2: mov a,m ;Get an entry ora a ;Check for end of the table jz zret ;Yes, select error cmp c ;Check if entry matches selected drive jz mfl3 inx h ;Skip onfiguration byte inx h ;Skip drive type inx h ;Skip DPB address inx h jmp mfl2 mfl3: inx h mov a,m ;Pick up drive type sta mfcon inx h mov a,m inx h mov h,m mov l,a ;DPB address -> (hl) push h ;Save DPB address call mfgdph ;Get DPH lxi d,10 ;Offset to DPB address in DPH dad d pop d mov m,e ;Store DPB address in DPH inx h mov m,d call mfgdph push h call dmstat ;Get status pop h ani 80h ;Check density bit mvi c,3 ;512 byte sectors rnz mvi c,2 ;256 byte sectors ret mfgdph lda mflog lxi d,dphmf0 jmp retdph mfcon: db 0 mflog: db 0 mfs: db 10h ;North Star db 0 ;Single density, 35 tracks, single sided. dw dpbmf0 db 90h ;North Star db n.dubl ;Double density, 35 tracks, single sided. dw dpbmf1 db 0b0h ;North Star db n.dubl ;Double density, 35 tracks, single sided. dw dpbmf2 db 0f0h ;North Star db n.dubl+n.2side ;Double density, 35 tracks, souble sided dw dpbmf3 db 0e5h ;North Star. Default format db n.dubl ;Double density, 35 tracks, single sided. dw dpbmf1 db 0 mfxltd db 1, 2, 3, 4 db 21,22,23,24 db 5, 6, 7, 8 db 25,26,27,28 db 9,10,11,12 db 29,30,31,32 db 13,14,15,16 db 33,34,35,36 db 17,18,19,20 db 37,38,39,40 mfxlts db 1, 2 db 3, 4 db 5, 6 db 7, 8 db 9,10 db 11,12 db 13,14 db 15,16 db 17,18 db 19,20 endif ***************************************************************** * * * Common routines for the DJDMA with 8 and 5 1/4 inch drives * * * ***************************************************************** dmsel2: mov c,a ;Move drive into (c) lxi h,dmchan mvi m,setlog ;Set logical drives inx h mov m,b ;Drive in (b) push b call docmd pop b jmp dmsel dmssec: push b ;Save sector number mov a,b rlc ani 1 mov c,a call dmside pop b jmp dmsec dmdma lxi h,dmchan ;Default channel address mvi m,dmsdma ;Set DMA address inx h mov m,c ;Low byte first inx h mov m,b ;High byte next docmd xra a inx h mov m,a docmd2 inx h mvi m,haltc inx h mov m,a out dmkick tests ora m jz tests ret dminit lxi h,dmchan ;See if controller will halt mvi m,haltc inx h mvi m,0 out dmkick ;Start controller lxi d,0 ;Set up timeout counter dminwt mov a,m ora a jnz dmiok ;Controller has responded dcx d ;Bump timeout counter mov a,d ora e jnz dminwt stc ;Set error flag ret dmiok dcx h ;Back to start of command mvi m,setcrc inx h mvi m,1 xra a jmp docmd2 ;Do command dmerr jmp dmerr dmhome xra a mov c,a ;Put a zero into (c) for track zero dmseek mov a,c ;Enter with track in (c) sta lltrk ;Save for use later ret dmsec lda llss ;Load sector ani 80h ;Save side select bit stores ora c sta llss ret dmside mov a,c ;Move side bit into (a) ani 1 rrc ;Move around to bit 7 mov c,a ;Resave in (c) lda llss ani 7fh ;Mask out old side select bit jmp stores dmsel mov a,c ;Move drive into (a) sta lldrv dmden ret ;Double density only ; » Returî statuó iî thå (a) register in the form: ; ; 7 6 5 5 3 2 1 0 ; ^ ^ ^ ^ ^ ^ ^ ^ ; Density --------------+ | | | | | | | ; Side select -------------+ | | | | | | ; Double sided ---------------+ | | | | | ; 5 1/4 -------------------------+ | | | | ; Sector size MSB ------------------+ | | | ; Sector size LSB ---------------------+ | | ; Drive select MSB -----------------------+ | ; Drive select LSB --------------------------+ ; dmstat lxi h,dmchan mvi m,gstat ;Set up read status inx h lda lldrv ;Get last selected drive mov m,a ;Store drive in command inx h ;Skip over returned status inx h inx h call docmd ;Issue command lda llss ;Get side bit of last operation ani 80h rrc ;Move to bit 7 mov c,a lxi h,dmchan+1 ;Point to drive mov a,m ;Load drive ora c ani 4 ;Mask upper drive select bit for 5 1/4 rlc rlc ;Move to bit 4 ora m ;Put together with lower drive bits ora c mov c,a inx h mvi a,10h ;Double density bit ana m rlc ;20h rlc ;40h rlc ;80h for density bit ora c mov c,a inx h mvi a,3 ;Sector length mask ana m ;And in rlc ;Move to bits 2 & 3 rlc ora c mov c,a inx h mvi a,4 ;Mask for double sided bit ana m rlc ;8 rlc ;10 rlc ;20 ora c ret dmwrite mvi a,wrsect db 01 ;Ugh... dmread mvi a,rdsect lxi h,dmchan lxi d,lltrk-1 mvi b,4 cload mov m,a inx h inx d ldax d dcr b jnz cload dcx h call docmd lda dmchan+4 cpi 80h cmc ret lltrk db 0 llss db 1 lldrv db 0 dmlog db 0 endif ***************************************************************** * * * The follwing equates are for the HDDMA hard disk controller * * * ***************************************************************** if maxmw ne 0 ;HDDMA controller present ? if m5 ;Specifications for a Seagate Technology 506 cyl equ 153 ;Number of cylinders heads equ 4 ;Number of heads per cylinder precomp equ 64 ;Cylinder to start write precomensation lowcurr equ 128 ;Cylinder to start low current stepdly equ 30 ;Step delay (0-12.7 milliseconds) steprcl equ 30 ;Recalibrate step delay headdly equ 200 ;Settle delay (0-25.5 milliseconds) endif if m16a ;Specifications for an AMPEX DF516 cyl equ 192 heads equ 8 precomp equ 0 lowcurr equ 96 stepdly equ 1 steprcl equ 10 headdly equ 0 endif if m16c ;Specifications for an CMI 5616 cyl equ 256 heads equ 6 precomp equ 128 lowcurr equ 128 stepdly equ 2 steprcl equ 30 headdly equ 0 endif if m19 ;Specifications for an CMI 5619 cyl equ 306 heads equ 6 precomp equ 128 lowcurr equ 128 stepdly equ 2 steprcl equ 30 headdly equ 0 endif if m40 ;Specifications for a Quantum Q2040 cyl equ 255 heads equ 8 precomp equ 255 lowcurr equ 255 stepdly equ 0 steprcl equ 10 headdly equ 0 endif sectsiz equ 7 ;Sector size code (must be 3 for this Cbios) ; 0 = 128 byte sectors ; 1 = 256 byte sectors ; 3 = 512 byte sectors (default) ; 7 = 1024 byte sectors ; f = 2048 byte sectors ;Define controller commands dmaread equ 0 ;Read sector dmawrit equ 1 ;Write sector dmarhed equ 2 ;Find a sector dmawhed equ 3 ;Write headers (format a track) dmalcon equ 4 ;Load disk parameters dmassta equ 5 ;Sense disk drive status dmanoop equ 6 ;Null controller operation reset equ 54h ;Reset controller attn equ 55h ;Send a controller attention chan equ 50h ;Default channel address stepout equ 10h ;Step direction out stepin equ 0 ;Step direction in band1 equ 40h ;No precomp, high current band2 equ 0c0h ;Precomp, high current band3 equ 80h ;precomp, low current track0 equ 1 ;Track zero status wflt equ 2 ;Write fault from drive dready equ 4 ;Drive ready sekcmp equ 8 ;Seek complete ***************************************************************** * * * Drive Specification Table for the HD DMA hard disk controller * * * ***************************************************************** mwdst: db maxmw*mwlog ;Number of logical drives dw mwwarm ;Warm boot dw mwtran ;Sector translation dw mwldrv ;Select logical drive 1 (First time select) dw mwdrv ;Select logical drive 2 (General select) dw mwhome ;Home current selected drive dw mwseek ;Seek to selected track dw mwsec ;Select sector dw mwdma ;Set DMA address dw mwread ;Read a sector dw mwwrite ;Write a sector dw mwbad ;Return bad sector map info ***************************************************************** * * * Thå followinç arå thå lowesô leveì driveró foò thå Morro÷ * * Designó Harä Disë DMÁ controller. * * * ***************************************************************** mwwarm xra a call mwdrv ;Select drive A call mwhome ;Home and reset the drive lxi b,0 ;Make sure we are on track 0 call mwseek xra a sta mwhead ;Select head zero sta mwsectr ;Select sector 1 lxi h,buffer ;Load sector 1 into buffer shld dmadma call mwwread ;Read CCP into buffer rc ;Return if error lxi d,buffer+200h lxi h,ccp lxi b,200h ;Move 200h bytes call movbyt lxi h,ccp-200h ;Initial DMA address push h xra a push a ;Save first sector -1 mwwlod pop psw ;Restore sector pop h ;Restore DMA address inr a sta mwsectr cpi 6 ;Past BDOS ? rz ;Yes, all done inr h ;Update DMA address by 1024 bytes inr h inr h inr h shld dmadma push h push psw call mwwread ;Read in a sector jnc mwwlod ret ;Return with error mwwread mvi c,retries ;Retry counter mwwerr push b ;Save the retry count call mwread ;Read the sector Š pop b rnc dcr c ;Update the error count jnz mwwerr ;Keep trying if not too many errors stc ;Set error flag ret mwldrv sta mwcurl ;Save current logical drive call mwreset ;Reset controller card jc zret ;Controller failure lda mwcurl call mwdrv ;Select drive jc zret ;Select error call mwstat ;Get drive status ani dready ;Check if drive ready jnz zret call mwhome ;Home drive lxi d,dphmw0 ;Start of hard disk DPH's lda mwcurl mov l,a mvi h,0 dad h dad h dad h dad h dad d ;(hl) = pointer to DPH mvi c,4 ;Return sector size of 1024 ret mwdrö sta mwcurl call mwdlog mov a,c sta mwdrive ;Save new selected drive mwsel mvi a,dmanoop jmp mwprep ;Execute disk command mwdlog: mvi c,0 mwllx: sui mwlog rc inr c jmp mwllx mwstat mvi a,dmassta ;Sense status operation code jmp mwprep ;Execute disk command mwhome call mwreset ;Reset controller lxi h,dmarg1 ;Load arguments mvi m,steprcl ;Load step delay (slow) inx h mvi m,headdly ;Head settle delay call mwissue ;Do load constants again call mwptr ;Get pointer to current cylinder number mvi m,0ffh ;Fake at cyl 255 for max head travel inx h mvi m,0ffh lxi b,0 ;Seek to cylinder 0 call mwseek ;Recal slowly jmp mwreset ;Back to fast stepping mode mwbad: lxi h,mwbtab ;Return pointer to bad sector location ret mwbtab: dw 0 ;Track 0 dw 19 ;Head 2, sector 0 = (2 * SPT + 0) + 1 mwseek calì mwptr ;Geô tracë pointer mov e,m ;Get old track number inx h mov d,m dcx h mov m,c ;Store new track number inx h mov m,b mov l,c ;Build cylinder word mov h,b shld dmarg0 ;Set command channel cylinder number mov a,d inr a lxi h,0ffffh jnz mwskip0 mvi c,stepout jmp mwskip mwskip0:mov h,b ;(hl) = new track, (de) = old track mov l,c call mwhlmde mvi c,stepout mov a,h ani 80h ;Check hit bit for negitive direction jnz mwsout ;Step in mvi c,0 jmp mwskip mwsout: call mwneghl mwskip: shld dmastep lda mwdrive ora c sta dmasel0 mvé a,dmanooð ;No-operatioî commanä foò thå channel call mwprep ;Step to proper track lxi h,0 ;Clear step counter shld dmastep ret mwdma mov h,b ;Set DMA address mov l,c shld dmadma ret mwsec mov a,c ;Load sector number dcr a ;Range is actaully 0-16 call mwdspt ;Figure out head number -> (c) adi mwspt ;Make sector number sta mwsectr mov a,c sta mwhead ;Save head number ret mwdspt mvi c,0 ;Clear head counter mwdsptx sui mwspt ;Subtract a tracks worth of sectors rc ;Return if all done inr c ;Bump to next head jmp mwdsptx mwreset out reset ;Send reset pulse to controller lxi h,dmachan ;Address of command channel shld chan ;Default channel address xra a sta chan+2 ;Clear extended address byte lxi h,dmarg1 ;Load arguments mvi m,stepdly ;Load step delay inx h mvi m,headdly ;Head settle delay inx h mvi m,sectsiz ;Sector size code inx h mvi m,dmalcon ;Load constants command jmp mwissue ;Do load constants mwread mvi a,dmaread ;Load disk read command jmp mwprep mwwrite mvi a,dmawrit ;Load disk write command mwprep sta dmaop ;Save command channel op code mvi c,band1 lhld dmarg0 lxi d,precomp call mwhlcde jc mwpreps mvi c,band2 lxi d,lowcurr call mwhlcde jc mwpreps mvi c,band3 ;cylinder > low_current mwpreps lda mwhead ;Load head address sta dmarg2 cma ;Negative logic for the controller ani 7 ;3 bits of head select rlc ;Shove over to bits 2 - 4 rlc ora c ;Add on low current and precomp bits mov c,a lda mwdrive ;Load drive address ora c ;Slap in drive bits sta dmasel1 ;Save in command channel head select lda mwsectr ;Load sector address sta dmarg3 mwissue lxi h,dmastat ;Status byte mvi m,0 out attn ;Start controller lxi d,0 ;Time out counter mov b,e ;Controller busy status mwiloop mov a,m ;Get status ora a ;Set up CPU flags rm ;Return no error (carry reset) stc rnz ;Return error status xthl ;Waste some ime xthl xthl xthl dcx d ;Bump timeout counter mov a,d ora e jnz mwiloop ;Loop if still busy stc ;Set error flag ret mwptr lda mwdrive ;Get currently select drives track address rlc mov e,a mvi d,0 lxi h,mwtab dad d ;Offset into track table ret mwtran: mov h,b mov l,c inx h ret mwneghl:mov a,h cma mov h,a mov a,l cma mov l,a inx h ret mwhlmde:xchg call mwneghl xchg dad d ret mwhlcde:mov a,h cmp d rnz mov a,l cmp e ret mwtab equ $ ;Collection of track addresses rept maxmw db 0ffh ;Initialize to (way out on the end of the disk) db 0ffh endm db 0ffh mwcurl db 0 ;Current logical drive mwdrive db 0ffh ;Currently selected drive mwhead db 0 ;Currently selected head mwsectr db 0 ;Currently selected sector dmachan equ $ ;Command channel area dmasel0 db 0 ;Drive select dmastep dw 0 ;Relative step counter dmasel1 db 0 ;Head select dmadma dw 0 ;DMA address db 0 ;Extended address dmarg0 db 0 ;First argument dmarg1 db 0 ;Second argument dmarg2 db 0 ;Third argument dmarg3 db 0 ;Fourth argument dmaop db 0 ;Operation code dmastat db 0 ;Controller status byte dmalnk dw dmachan ;Link address to next command channel db 0 ;extended address endif ***************************************************************** * * * Cbios ram locations that don't need initialization. * * * ***************************************************************** cpmsec: dw 0 ;CP/M sector # cpmdrv: db 0 ;CP/M drive # cpmtrk: dw 0 ;CP/M track # truesec:dw 0 ;Physical sector that contains CP/M sector bufdrv: db 0 ;Drive that buffer belongs to buftrk: dw 0 ;Track that buffer belongs to bufsec: dw 0 ;Sector that buffer belongs to alttrk: dw 0 ;Alternate track altsec: dw 0 ;Alterante sector lastdrv:db 0 ;Last selected drive ***************************************************************** * * * DPB and DPH area. * * * ***************************************************************** if maxhd ne 0 dphdsk set 0 ;Generate DPH's for the hdc3 hard disks rept maxhd ldsk set 0 rept hdlog dphgen hd,%dphdsk,dpbhd,%ldsk dphdsk set dphdsk+1 ldsk set ldsk+1 endí endm if hdpart ne 0 ;Use non-standard partitioning if m10 ne 0 hdsecpt equ 336 ;Sectors per track hdbls equ 2562 ;Total blocks hdtrks equ 244 ;Total tracks endif if m20 ne 0 hdsecpt equ 672 hdbls equ 5124 hdtrks equ 244 endif if m26 ne 0 hdsecpt equ 1024 hdbls equ 6464 hdtrks equ 202 endif ldsk set 0 ;Generate DPB's for a hdc3 hard disk rept hdlog if ldsk eq 0 ;On logical drive 0 dsm set (hdbls/hdlog)-(hdbls/hdtrks+1) ; take off a tracks worth else dsm set hdbls/hdlog endif off set (hdtrks/hdlog)*ldsk+1 dpbgen hd,%ldsk,%hdsecpt,5,31,1,%dsm,511,0ffh,0ffh,0,%off ldsk set ldsk+1 endm else ;Else use standard DPH's if m26 ne 0 dpbhd0 dw 1024 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 1973 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 1 ;OFF dpbhd1 dw 1024 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 1973 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 64 ;OFF dpbhd2 dw 1024 ;CP/M sectors/track db 5 ;BSH Š db 31 ;BLM db 1 ;EXM dw 1973 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 127 ;OFF endif if m10 ne 0 dpbhd0 dw 336 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 1269 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 1 ;OFF dpbhd1 dw 336 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 1280 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 122 ;OFF endif if m20 ne 0 dpbhd0 dw 672 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 2015 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 1 ;OFF dpbhd1 dw 672 ;CP/M sectors/track Š db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 2015 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 98 ;OFF dpbhd2 dw 672 ;CP/M sectors/track db 5 ;BSH db 31 ;BLM db 1 ;EXM dw 1028 ;DSM dw 511 ;DRM db 0ffh ;AL0 db 0ffh ;AL1 dw 0 ;CKS dw 195 ;OFF endif endif endiæ ;Enä oæ HÄ DPH'ó anä DPB's if maxmf ne 0 dpbgen mf,0, 20, 3, 7, 0, 04fh, 63, 0c0h, 0, 16, 3 dpbgen mf,1, 40, 4, 15, 1, 051h, 63, 80h, 0, 16, 2 dpbgen mf,2, 40, 3, 7, 0, 0a4h, 63, 0c0h, 0, 16, 2 dpbgen mf,3, 40, 4, 15, 1, 0a9h, 63, 80h, 0, 16, 2 dn set 0 rept maxmf dphgen mf,%dn,dpbmf,%dn dn set dn+1 endm endif if maxfd ne 0 dn set 0 rept maxfd dphgen fd,%dn,0,0 dn set dn+1 endm endif if maxdm ne 0 dn set 0 rept maxdm dphgen dm,%dn,0,0 dn set dn+1 endm endif if maxmw ne 0 ***************************************************************** * * * mwsectp is the number of 128 byte sectors per cylinder. * * mwsectp = 2.25 * heads * * * * mwtrks is the total number of data cylinders. * * mwtrks = tracks - 1 * * * * mwbls is the total number of 4096 byte blocks. * * mwbls = mwsecpt*mwtrks/32 * * * ***************************************************************** if m5 ne 0 mwsecpt equ 288 ;Sectors per track mwbls equ 1368 ;Total data blocks (4096 byte) mwtrks equ 152 ;Total data tracks endif if m16a ne 0 mwsecpt set 576 mwbls set 3438 mwtrks set 191 endif if m16c ne 0 mwsecpt set 432 mwbls set 3442 mwtrks set 255 endif if m19 ne 0 mwsecpt set 432 mwbls set 4117 mwtrks set 305 endif if m40 ne 0 mwsecpt set 576 mwbls set 9198 mwtrks set 511 endif dphdsk set 0 ;Generate DPH's for the HDDMA hard disks rept maxmw ldsk set 0 rept mwlog dphgen mw,%dphdsk,dpbmw,%ldsk dphdsk set dphdsk+1 ldsk set ldsk+1 endí endm if mwpart ne 0 ;Generate DPB's for a HDDMA hard disk ldsk set 0 ;Use non-standard partitioning rept mwlog dsm set mwbls/mwlog-1 off set (mwtrks/mwlog)*ldsk+1 dpbgen mw,%ldsk,%mwsecpt,5,31,1,%dsm,511,0ffh,0ffh,0,%off ldsk set ldsk+1 endm else ;Use standard partitioning blocks set mwbls off set 1 trkoff set 8000h/(mwsecpt*10h/32)+1 ldsk set 0 rept mwbls/2048 ;Generate some 8 megabyte DPB's dpbgen mw,%ldsk,%mwsecpt,5,31,1,2047,511,0ffh,0ffh,0,%off off set off+trkoff blocks set blocks-2048 ldsk set ldsk+1 endm if blocks gt 256 ;If there is any stuff left, then use it blocks set blocks-1 dpbgen mw,%ldsk,%mwsecpt,5,31,1,%blocks,511,0ffh,0ffh,0,%off endif endif endif buffer equ $ ***************************************************************** * * * Signon message output during cold boot. * * * ***************************************************************** prompt: db 80h, clear ;Clean buffer and screen db acr,alf,acr,alf,acr,alf db 'Morrow Designs ' db '0'+msize/10 ;CP/M memory size db '0'+(msize mod 10) db 'K CP/M ' ;CP/M version number db cpmrev/10+'0' db '.' db (cpmrev mod 10)+'0' db (revnum/10)+'A'-1 if (maxhd ne 0) or (maxmw ne 0) db ' + ' if maxhd ne 0 if m10 ne 0 db 'M10' endif if m20 ne 0 db 'M20' endif if m26 ne 0 db 'M26' endif if maxmw ne 0 db ' + ' endif endif if maxmw ne 0 if m5 ne 0 db 'Seagate M5' endif if m16a ne 0 db 'Ampex M16' endif if m16c ne 0 db 'CMI M16' endif if m19 ne 0 db 'CMI M19' endif if m40 ne 0 db 'Quantum M40' endif endif endif db acr,alf db 0 ;End of message ***************************************************************** * * * Cboot is the cold boot loader. All of CP/M has been loaded in * * when control is passed here. * * * ***************************************************************** cboot: lxi sp,tpa ;Set up stack xra a ;Clear cold boot flag sta cwflg sta group ;Clear group select byte mvi a,intioby sta iobyte lxi d,badmap ;Clear out bad map stax d lxi h,badmap+1 lxi b,9*badsiz ;32 map entries call movbyt mvi m,0ffh ;End marker if contyp ne 0 ;Do not call tinit for PROM's call tinit ;Initialize the terminal endif if lsttyp ne 0 ;Do not call linit for PROM's call linit ;Initialize the list device endif lxi h,prompt ;Prep for sending signon message call message ;Send the prompt xra a ;Select disk A sta cpmdrv sta cdisk lxi h,bios+3 ;Patch cold boot to warm code shld bios+1 jmp gocpm if contyp eq 2 ;Multi I/O, Decision I ***************************************************************** * * * Terminal initilization routine. This routine reads the sense * * switch on the WB-14 and sets the speed accordingly. * * * ***************************************************************** tinit: lda group ;Get group byte ori congrp ;Select console device out grpsel mvi a,dtrenb+rtsenb ;Enable DTR and RTS outputs to terminal out mcr in rbr ;Clear reciever buffers in rbr xra a out lsr ;Clear status out ier ;Set no interrupts if not multr3 ;Multi I/O has no sense switches lda group ;Get group byte out grpsel ;Select group zero to read sense switch in sensesw ;Get sense switch. ani 0e0h ;Mask in upper three bits rlc rlc rlc ;Move into lower 3 bits cpi 7 ;check for sense = 7 push psw ;Save value lda group ;Get group byte ori congrp ;Reselect serial port group out grpsel pop psw jz valid ;Do default rate lxi h,btab ;Pointer to baud rate table add a ;Table of words so double mov e,a ;Make a 16 bit number into (de) mvi d,0 dad d ;Get a pointer into baud rate table mov e,m ;Get lower byte of word inx h ;Point to high byte of word mov d,m ;Get upper byte. (de) now has divisor jmp setit ;Set baud rate. btab: dw 1047 ;110 Baud 000 dw 384 ;300 001 dw 96 ;1200 010 dw 48 ;2400 011 dw 24 ;4800 100 dw 12 ;9600 101 dw 6 ;19200 110 else jmp valid ;Skip over table endif ***************************************************************** * * * The following is a list of valid baud rates. The current * * baud rate is checked on cold boot. If it is not in the * * vtab table then the baud rate will be set from the defcon * * word found below the Cbios jump table. If the user * * happens to have a weird baud rate that is not in this * * table or is looking for a way to save space then entries * * can be added or deleted from the table. * * * ***************************************************************** vtab: dw 2304 ;50 baud dw 1536 ;75 dw 1047 ;110 dw 857 ;134.5 dw 768 ;150 dw 384 ;300 dw 192 ;600 dw 96 ;1200 dw 64 ;1800 dw 58 ;2000 dw 48 ;2400 dw 32 ;3600 dw 24 ;4800 dw 16 ;7200 dw 12 ;9600 dw 6 ;19200 svtab equ ($-vtab)/2 ;Length of the vtab table ***************************************************************** * * * Valid checks if the divisor latch is a reasonable value. * * If the value seems off then it will get the default baud * * rate from defcon and jump to setit. * * * ***************************************************************** valid: mvi a,dlab+wls0+wls1+stb out lcr ;Access divisor latch in dll ;Get lower divisor value mov e,a in dlm ;Get upper divisor value mov d,a mvi a,wls1+wls0+stb out lcr lxi h,vtab ;Valid baud rate table mvi c,svtab ;Length of the baud rate table vloop: mov a,e cmp m ;Check low byte jnz vskip ;First byte is bad inx h mov a,d cmp m ;Check high byte jz done ;Baud rate is OK... Do cleanup dcx h vskip: inx h ;Skip to next entry inx h dcr c ;Bump entry counter jnz vloop nvalid: lhld defcon ;Get default baud rate xchg setit: mvi a,dlab+wls1+wls0+stb ;Enable divisor access latch out lcr ;Set the baud rate in (de) mov a,d out dlm ;Set upper divisor mov a,e out dll ;Set lower divisor mvi a,wls1+wls0+stb out lcr done: xra a ;Clear status register out lsr ret endif ;Multi I/O, Decision I if contyp eq 3 ;2D/B console initialization tinit: call fdtstat ;Clean input buffer rnz ;All empty call fdcin jmp tinit endif ;2D/B console if contyp eq 4 tinit: call dminit ;See if controller present rc ;No controller, return lxi d,dmaci ;Console initialization command sequence lxi h,dmchan lxi b,10 ;Command length call movbyt dcx h xra a ;Clear serial input status sta serin+1 jmp docmd2 ;Do stuff and return dmaci: db writem ;Zot monitor disable flag dw tinit ;Any non-zero byte will do db 0 dw 1 ;One byte dw 13f5h ;Magical place in monitor db senabl ;Enable serial input db 1 endif if (lsttyp ge 2) and (lsttyp le 5) ;Serial Multi I/O list drivers linit: lda group ;Get group byte ori lstgrp ;Select list device out grpsel mvi a,dlab ;Access divisor latch out lcr lhld deflst ;Get LST: baud rate divisor mov a,h out dlm ;Set upper baud rate mov a,l out dll mvi a,stb+wls0+wls1 out lcr in rbr ;Clear input buffer xra a out ier ;No interupts ret endif if lsttyp eq 6 ;Multi I/O parallel, Centronics linit: lda group ;Get group byte ori denable ;Set driver enable bit sta group out grpsel ;Select group zero with drivers enabled xra a out daisi1 ;Zero out data mvi a,d9+d10 ;Set strobe high, init low out daisi0 mvi a,10 ;Wait about 50uS for printer to initilize dloop: dcr a jnz dloop mvi a,d11+d9+d10 out daisi0 ret endif if lsttyp eq 7 ;Diablo HyType II ***************************************************************** * * * Initialize Diablo HyType printer. If the printer fails * * to initialize then the output drivers will be turned off * * and any attempts to print will result in redirection to * * the console. * * * ***************************************************************** if multr3 ;Multi I/O initialization linit: lda group ;Get group byte ori denable ;Add driver enable bit out grpsel ori rest ;Toggle restore high out grpsel mvi a,10 ;Hold line up for 50uS dloop: dcr a jnz dloop lda group out grpsel ;Turn denable and restore off else ;Mother board initialization linit: lda group ;Get group byte out grpsel ;Select group zero mvi a,pselect+rlift ;Set select line active, rlift not active out clk mvi a,0ffh out daisi0 mvi a,0ffh-rest ;Strobe restore bit low out daisi0 mvi a,10 ;Wait about 50uS dloop: dcr a jnz dloop mvi a,0ffh ;Raise restore back up out daisi0 endif xra a out daisi1 ;Clear data buffers if multr3 ;Lift ribbon lda group ori denable out grpsel ;Re-enable the drivers mvi a,0ffh-rest ;Pull -ribbon lift down out daisi0 else mvi a,pselect ;Re-enable drivers and lift ribbon out clk endif linit9: lxi h,hinc/cperi shld hmi ;Save hmi = 120/(characters per inch) lxi h,vinc/lperi shld vmi ;Save vmi = 48/(lines per inch) lxi h,0 ;Other variables default to zero shld vpos shld dlvpos shld hpos shld dlhpos shld lmar call clrall ;Clear the TAB array xra a sta kludge ;Reset TAB clear byte sta dirflg sta grhflg ret endif db 0,0ffh,0 codelen equ ($-bios) ;Length of Cbios code if debug dbgtmp set codelen ;Cbios code length ! endif ds 512-($-buffer) ;Maximum size buffer for 512 byte sectors if (maxfd ne 0) or (maxdm ne 0) or (maxmw ne 0) ds 512 ;Additional space for 1k sector devices endif ***************************************************************** * * * Each bad map entry consists of 9 bytes: * * Logical drive number (1 byte) * * Track number of bad sector (2 bytes) * * Sector number of bad sector (2 bytes) * * Track number of alternate sector (2 bytes) * * Sector number of alternate sector (2 bytes) * * * ***************************************************************** badmap: ds badsiz*9+1 ;32 entries + end marker dirbuf: ds 128 ;Directory buffer ***************************************************************** * * * Allocation and checked directory table area * * * ***************************************************************** if maxhd ne 0 if hdpart ne 0 ;Use non-standard partitioning dn set 0 rept maxhd ;Generate CKS and ALV tables ldsk set 0 rept hdlog if ldsk eq 0 ;On logical drive 0 dsm set (hdbls/hdlog)-(hdbls/hdtrks+1) ; take off a tracks worth else dsm set hdbls/hdlog endif alv set (dsm/8)+1 alloc hd,%dn,%((hdbls/hdlog)/8)+1,0 ldsk set ldsk+1 dn set dn+1 endm endm else ;Standard partitioning dn set 0 rept maxhd if m26 ne 0 alloc hd,%dn,247,0 dn set dn+1 alloc hd,%dn,247,0 dn set dn+1 alloc hd,%dn,247,0 dn set dn+1 endif if m10 ne 0 alloc hd,%dn,159,0 dn set dn+1 alloc hd,%dn,161,0 dn set dn+1 Š endif if m20 ne 0 alloc hd,%dn,252,0 dn set dn+1 alloc hd,%dn,252,0 dn set dn+1 alloc hd,%dn,129,0 dn set dn+1 endif endm endif endif if maxfd ne 0 dn set 0 rept maxfd alloc fd,%dn,75,64 dn set dn+1 endm endif if maxdm ne 0 dn set 0 rept maxdm alloc dm,%dn,75,64 dn set dn+1 endm endif if maxmf ne 0 dn set 0 rept maxmf alloc mf,%dn,22,16 dn set dn+1 endm endif if maxmw ne 0 if mwpart ne 0 ;Use non-standard partitioning dn set 0 rept maxmw*mwlog alv set ((mwbls/mwlog)/8)+1 alloc mw,%dn,%alv,0 dn set dn+1 endm else ;Use standard partitioning dn set 0 rept maxmw blocks set mwbls rept mwbls/2048 ;Generate some 8 megabyte ALV's alloc mw,%dn,257,0 blocks set blocks-2048 dn set dn+1 endm if blocks gt 256 ;If there is any stuff left, then use it alv set (blocks/8)+1 alloc mw,%dn,%alv,0 dn set dn+1 endif endm endif endif end